%topiclabel
',
+ sourceItemDisabled: '%topiclabel
'
+ };
+
+ var getJSONData = function (key) {
+ var dataSet = {};
+ for (var i = 0; i < jsonData.length; i++) {
+ if (jsonData[i].hasOwnProperty(key)) {
+ dataSet = jsonData[i];
+ }
+ }
+ return dataSet;
+ };
+
+/*
+ var stripeList = function (list) {
+ $("div.even", list).removeClass("even");
+ $("div:nth-child(even)", list).addClass("even");
+ };
+*/
+
+ var clearHighlight = function (rowElm) {
+ rowElm = (rowElm) ? $(rowElm) : $("div.highlight");
+ rowElm.removeClass("highlight");
+ };
+
+ var updateSourceCounter = function (count) {
+ count = (count !== undefined) ? count : $("div:visible",sourceList).length;
+ $(".topic-source-counter", container).text(count);
+ };
+
+ var filterList = function () {
+ var forumFilter = $(".forumDropdown").val();
+ var filteredItems = $("div", sourceList);
+ filteredItems.removeClass('shown-by-filter');
+
+ if (forumFilter === "select-forum") {
+ filteredItems.addClass('shown-by-filter');
+ filteredItems.show();
+ } else {
+ // convert the filter strings to classNames if not empty
+ forumFilter = (forumFilter === "select-forum") ? "" : "." + forumFilter;
+ // hide all rows
+ filteredItems.hide();
+ // show the rows with the right classes
+ filteredItems = $("div" + forumFilter , sourceList);
+ filteredItems.addClass('shown-by-filter');
+ filteredItems.show();
+ }
+ // restore the text filter if it's not empty
+ if ($("#searchTopic").val().replace(/^\s+|\s+$/g, '') !== "") {
+ searchByName();
+ } else {
+ updateSourceCounter(filteredItems.length);
+ }
+
+/*
+ // clear radio buttons
+
+ // disable Move Threads button
+ $(".topic-btn-save").attr("disabled", "disabled");
+*/
+ };
+
+ var saveRestorePoint = function () {
+ $("#searchTopic").val("");
+ $(".forumDropdown").val("select-forum");
+
+
+ };
+
+ var searchByName = function () {
+ var contents = $("#searchTopic").val().replace(/^\s+|\s+$/g, '').toLowerCase();
+ if (!(contents === "")) {
+ var regex = new RegExp("\\b" + contents);
+ $(".shown-by-filter", sourceList).each(function () {
+ var item = $(this);
+ var name = item.text().replace(/^\s+|\s+$/g, '').toLowerCase();
+
+ // use toggle here
+ if (name.search(regex) > -1) {
+ item.show();
+ }
+ else {
+ item.hide();
+ }
+ });
+ updateSourceCounter();
+ }
+ else {
+ filterList();
+ }
+ };
+
+ var buildForumSelect = function () {
+ var forum;
+ var forumOptionTemplate = $('#select-forum');
+ var forumOption;
+ var forums= getJSONData("forums").forums;
+ for (var i = 0; i < forums.length; i++) {
+ forum= forums[i];
+ forumOption = forumOptionTemplate.clone(true);
+ forumOption.text(forum.forumtitle);
+ forumOption.val(forum.forumid);
+ forumOption.data('forum', forums[i]);
+ forumFilterSelect.append(forumOption);
+ }
+ };
+
+ var makeSourceListItem = function (topics) {
+ var itemHTML = fluid.stringTemplate(templates.sourceItem, {
+ forumid: topics.forumid,
+ topicvalue: topics.topicid,
+ topiclabel: topics.topictitle
+ });
+ return itemHTML;
+ };
+
+ var makeSourceListItemDisabled = function (topics) {
+ var itemHTML = fluid.stringTemplate(templates.sourceItemDisabled, {
+ forumid: topics.forumid,
+ topicvalue: topics.topicid,
+ topiclabel: topics.topictitle
+ });
+ return itemHTML;
+ };
+
+ var buildThreadList = function() {
+ var idlist = [];
+ var itemHTML = "";
+ // #checkbox is the in dfAllMessages.jsp
+ // we want to find out which messages are selected to move,
+
+ $("#checkbox input[type=checkbox]:checked").each(function() {
+ var threadid = ($(this).val());
+ idlist.push(threadid);
+ var thetitle = $(this).parent().siblings(".messageTitle").find(".messagetitlelink").text();
+ itemHTML += " - " + thetitle + "
"; + }); + + $(".threads-to-move", container).html(itemHTML); + } + + var buildSourceListScroller = function () { + var itemHTML = ""; + var topics= getJSONData("topics").topics; + var totalTopics= topics.length; + for (var j = 0; j < totalTopics; j++) { + var sourcetitle = $(".sourcetitle").text(); + var currtopic = topics[j].topictitle ; + if ( sourcetitle == currtopic) { + // if current topic, greyed out disable radio selection + itemHTML += makeSourceListItemDisabled(topics[j]); + } + else { + itemHTML += makeSourceListItem(topics[j]); + } + } + $(sourceList).html(itemHTML); +/* + if (window.parent.recipientData) { + restoreSourceListSettings(); + } +*/ + $(".topic-source-total, .topic-source-counter", container).text(totalTopics); + }; + + /* KEYBOARD NAVIGATION + */ + + var moveThreadEnabled = function (){ + //function to check total number of CheckBoxes that are checked in a form + //initialize total count to zero + var totalChecked = 0; + //get total number of CheckBoxes in form + if (typeof document.forms['msgForum'].moveCheckbox.length === 'undefined') { + /*when there is just one checkbox moveCheckbox is not an array, document.forms['msgForum'].moveCheckbox.length returns undefined */ + if (document.forms['msgForum'].moveCheckbox.checked == true ) + { + totalChecked += 1; + } + } + else { + // more than one checkbox is checked. + var chkBoxCount = document.forms['msgForum'].moveCheckbox.length; + //loop through each CheckBox + for (var i = 0; i < chkBoxCount; i++) + { + //check the state of each CheckBox + if (eval("document.forms['msgForum'].moveCheckbox[" + i + "].checked") == true) + { + //it's checked so increment the counter + totalChecked += 1; + } + } + } + if (totalChecked >0){ + // enable the move link + return true; + } + else { + return false; + } + + } + + /* SETUP DOM EVENTS */ + + var bindDOMelements = function () { + + $(".topic-btn-save").click(function () { + // call processMoveThread + var linkid = "msgForum:hidden_move_message_commandLink"; + var hiddenmovelink = document.getElementById(linkid); + hiddenmovelink.onclick(); +// $(".topic-picker").dialog("close"); + }); + + $("#searchTopic").keyup(function (event) { + if (event.keyCode === $.ui.keyCode.ESCAPE || $(this).val() === "") { + //if esc is pressed we want to clear the value of search box + $(this).val(""); + filterList(); + } else { + searchByName(); + } + }); + + $(".checkbox-reminder").click(function () { + var reminder = $("#checkbox-reminder:checked").val(); + if (reminder != undefined) { + // reminder checkbox is checked + $(".moveReminder").val(true); + } + else { + // reminder checkbox is NOT checked + $(".moveReminder").val(false); + } + }); + + $(".topic-btn-cancel").click(function () { + $(".topic-picker").dialog("close"); + }); + + $('input:radio',sourceList).click(function () { + var radiovalue = $(this).val(); + // enable Move Threads button + $(".topic-btn-save").removeAttr("disabled"); + var topichidden = $(".selectedTopicid"); + $(".selectedTopicid").val(radiovalue); + }); + + $(sourceList).click(function (event) { + var elm = ($(event.target).is('div')) ? $(event.target) : $(event.target).parent("div"); + // addSingleRow(elm); + }); + + $(".forumDropdown").change(function () { + filterList(); + }); + + $(".display-topic-picker").click(function () { + if (moveThreadEnabled()) { + buildThreadList(); + //buildSourceListScroller(); + $(".topic-picker").dialog("open"); + //saveRestorePoint(); + } + else { + // do nothing + } + }); + + }; + + /* Initialization Routine */ + + var parseData = function () { + var txtData = $("#data").text(); + jsonData = JSON.parse(txtData, null); + }; + + var collectElements = function () { + container = $("#topic-picker"); + forumFilterSelect = $(".forumDropdown", container); + sourceList = $(".topic-source-list", container); + sourceStructure = $(".topic-source", container); + }; + + var initDialog = function () { + $.ui.dialog.defaults.bgiframe = true; + $(".topic-picker").dialog({ autoOpen: false, width: 660, modal: true, position: 'top'}); + }; + + $(function () { + window.parent.scrollTo(0,0); + parseData(); + collectElements(); + initDialog(); + sourceListScroller = fluid.scroller($(".topic-source-scroller-inner"), { maxHeight: 270}); + //buildThreadList(); + buildSourceListScroller(); + buildForumSelect(); + $(".forumDropdown").val("select-forum"); + filterList(); + bindDOMelements(); + // stripeList(sourceList); + }); + +})(jQuery, fluid_1_0); Property changes on: messageforums-app/src/webapp/js/forum_movethread.js ___________________________________________________________________ Added: svn:eol-style + native Index: messageforums-app/src/webapp/js/ui.dialog.js =================================================================== --- messageforums-app/src/webapp/js/ui.dialog.js (revision 0) +++ messageforums-app/src/webapp/js/ui.dialog.js (revision 0) @@ -0,0 +1,650 @@ +/* + * jQuery UI Dialog 1.7 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * ui.core.js + * ui.draggable.js + * ui.resizable.js + */ +(function($) { + +var setDataSwitch = { + dragStart: "start.draggable", + drag: "drag.draggable", + dragStop: "stop.draggable", + maxHeight: "maxHeight.resizable", + minHeight: "minHeight.resizable", + maxWidth: "maxWidth.resizable", + minWidth: "minWidth.resizable", + resizeStart: "start.resizable", + resize: "drag.resizable", + resizeStop: "stop.resizable" + }, + + uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all '; + +$.widget("ui.dialog", { + + _init: function() { + this.originalTitle = this.element.attr('title'); + + var self = this, + options = this.options, + + title = options.title || this.originalTitle || ' ', + titleId = $.ui.dialog.getTitleId(this.element), + + uiDialog = (this.uiDialog = $('')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + position: 'absolute', + overflow: 'hidden', + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + (options.closeOnEscape && event.keyCode + && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event)); + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = this.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (this.uiDialogTitlebar = $('')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .mousedown(function(ev) { + ev.stopPropagation(); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + (options.draggable && $.fn.draggable && this._makeDraggable()); + (options.resizable && $.fn.resizable && this._makeResizable()); + + this._createButtons(options.buttons); + this._isOpen = false; + + (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe()); + (options.autoOpen && this.open()); + + }, + + destroy: function() { + (this.overlay && this.overlay.destroy()); + this.uiDialog.hide(); + this.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + this.uiDialog.remove(); + + (this.originalTitle && this.element.attr('title', this.originalTitle)); + }, + + close: function(event) { + var self = this; + + if (false === self._trigger('beforeclose', event)) { + return; + } + + (self.overlay && self.overlay.destroy()); + self.uiDialog.unbind('keypress.ui-dialog'); + + (self.options.hide + ? self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }) + : self.uiDialog.hide() && self._trigger('close', event)); + + $.ui.dialog.overlay.resize(); + + self._isOpen = false; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + + if ((this.options.modal && !force) + || (!this.options.stack && !this.options.modal)) { + return this._trigger('focus', event); + } + + if (this.options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = this.options.zIndex; + } + (this.overlay && this.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ)); + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') }; + this.uiDialog.css('z-index', ++$.ui.dialog.maxZ); + this.element.attr(saveScroll); + this._trigger('focus', event); + }, + + open: function() { + if (this._isOpen) { return; } + + var options = this.options, + uiDialog = this.uiDialog; + + this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null; + (uiDialog.next().length && uiDialog.appendTo('body')); + this._size(); + this._position(options.position); + uiDialog.show(options.show); + this.moveToTop(true); + + // prevent tabbing out of modal dialogs + (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode != $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first')[0], + last = tabbables.filter(':last')[0]; + + if (event.target == last && !event.shiftKey) { + setTimeout(function() { + first.focus(); + }, 1); + } else if (event.target == first && event.shiftKey) { + setTimeout(function() { + last.focus(); + }, 1); + } + })); + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $([]) + .add(uiDialog.find('.ui-dialog-content :tabbable:first')) + .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first')) + .add(uiDialog) + .filter(':first') + .focus(); + + this._trigger('open'); + this._isOpen = true; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ); + + // if we already have a button pane, remove it + this.uiDialog.find('.ui-dialog-buttonpane').remove(); + + (typeof buttons == 'object' && buttons !== null && + $.each(buttons, function() { return !(hasButtons = true); })); + if (hasButtons) { + $.each(buttons, function(name, fn) { + $('') + .addClass( + 'ui-state-default ' + + 'ui-corner-all' + ) + .text(name) + .click(function() { fn.apply(self.element[0], arguments); }) + .hover( + function() { + $(this).addClass('ui-state-hover'); + }, + function() { + $(this).removeClass('ui-state-hover'); + } + ) + .focus(function() { + $(this).addClass('ui-state-focus'); + }) + .blur(function() { + $(this).removeClass('ui-state-focus'); + }) + .appendTo(uiDialogButtonPane); + }); + uiDialogButtonPane.appendTo(this.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = this.options, + heightBeforeDrag; + + this.uiDialog.draggable({ + cancel: '.ui-dialog-content', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function() { + heightBeforeDrag = options.height; + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + (options.dragStart && options.dragStart.apply(self.element[0], arguments)); + }, + drag: function() { + (options.drag && options.drag.apply(self.element[0], arguments)); + }, + stop: function() { + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + (options.dragStop && options.dragStop.apply(self.element[0], arguments)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = this.options, + resizeHandles = typeof handles == 'string' + ? handles + : 'n,e,s,w,se,sw,ne,nw'; + + this.uiDialog.resizable({ + cancel: '.ui-dialog-content', + alsoResize: this.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: options.minHeight, + start: function() { + $(this).addClass("ui-dialog-resizing"); + (options.resizeStart && options.resizeStart.apply(self.element[0], arguments)); + }, + resize: function() { + (options.resize && options.resize.apply(self.element[0], arguments)); + }, + handles: resizeHandles, + stop: function() { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + (options.resizeStop && options.resizeStop.apply(self.element[0], arguments)); + $.ui.dialog.overlay.resize(); + } + }) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _position: function(pos) { + var wnd = $(window), doc = $(document), + pTop = doc.scrollTop(), pLeft = doc.scrollLeft(), + minTop = pTop; + + if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) { + pos = [ + pos == 'right' || pos == 'left' ? pos : 'center', + pos == 'top' || pos == 'bottom' ? pos : 'middle' + ]; + } + if (pos.constructor != Array) { + pos = ['center', 'middle']; + } + if (pos[0].constructor == Number) { + pLeft += pos[0]; + } else { + switch (pos[0]) { + case 'left': + pLeft += 0; + break; + case 'right': + pLeft += wnd.width() - this.uiDialog.outerWidth(); + break; + default: + case 'center': + pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2; + } + } + if (pos[1].constructor == Number) { + pTop += pos[1]; + } else { + switch (pos[1]) { + case 'top': + pTop += 0; + break; + case 'bottom': + pTop += wnd.height() - this.uiDialog.outerHeight(); + break; + default: + case 'middle': + pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2; + } + } + + // prevent the dialog from being too high (make sure the titlebar + // is accessible) + pTop = Math.max(pTop, minTop); + this.uiDialog.css({top: pTop, left: pLeft}); + }, + + _setData: function(key, value){ + (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value)); + switch (key) { + case "buttons": + this._createButtons(value); + break; + case "closeText": + this.uiDialogTitlebarCloseText.text(value); + break; + case "dialogClass": + this.uiDialog + .removeClass(this.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "draggable": + (value + ? this._makeDraggable() + : this.uiDialog.draggable('destroy')); + break; + case "height": + this.uiDialog.height(value); + break; + case "position": + this._position(value); + break; + case "resizable": + var uiDialog = this.uiDialog, + isResizable = this.uiDialog.is(':data(resizable)'); + + // currently resizable, becoming non-resizable + (isResizable && !value && uiDialog.resizable('destroy')); + + // currently resizable, changing handles + (isResizable && typeof value == 'string' && + uiDialog.resizable('option', 'handles', value)); + + // currently non-resizable, becoming resizable + (isResizable || this._makeResizable(value)); + break; + case "title": + $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' '); + break; + case "width": + this.uiDialog.width(value); + break; + } + + $.widget.prototype._setData.apply(this, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options; + + // reset content sizing + this.element.css({ + height: 0, + minHeight: 0, + width: 'auto' + }); + + // reset wrapper sizing + // determine the height of all the non-content elements + var nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + + this.element + .css({ + minHeight: Math.max(options.minHeight - nonContentHeight, 0), + height: options.height == 'auto' + ? 'auto' + : Math.max(options.height - nonContentHeight, 0) + }); + } +}); + +$.extend($.ui.dialog, { + version: "1.7", + defaults: { + autoOpen: true, + bgiframe: false, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: 'center', + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + getter: 'isOpen', + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid); + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + $(document).bind($.ui.dialog.overlay.events, function(event) { + var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0; + return (dialogZ > $.ui.dialog.overlay.maxZ); + }); + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + (dialog.options.closeOnEscape && event.keyCode + && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event)); + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = $('').appendTo(document.body) + .addClass('ui-widget-overlay').css({ + width: this.width(), + height: this.height() + }); + + (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe()); + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + this.instances.splice($.inArray(this.instances, $el), 1); + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + }, + + height: function() { + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + var scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + var offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + var scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + var offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +})(jQuery); Property changes on: messageforums-app/src/webapp/js/ui.dialog.js ___________________________________________________________________ Added: svn:eol-style + native Index: messageforums-app/src/webapp/js/ui.draggable.js =================================================================== --- messageforums-app/src/webapp/js/ui.draggable.js (revision 0) +++ messageforums-app/src/webapp/js/ui.draggable.js (revision 0) @@ -0,0 +1,766 @@ +/* + * jQuery UI Draggable 1.7 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.draggable", $.extend({}, $.ui.mouse, { + + _init: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + }, + + _mouseCapture: function(event) { + + var o = this.options; + + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + if(o.cursorAt) + this._adjustOffsetFromHelper(o.cursorAt); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Call plugins and callbacks + this._trigger("start", event); + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + this._trigger('drag', event, ui); + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + self._trigger("stop", event); + self._clear(); + }); + } else { + this._trigger("stop", event); + this._clear(); + } + + return false; + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left; + if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top; + if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var ce = $(o.containment)[0]; if(!ce) return; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + absolutePosition: this.positionAbs, //deprecated + offset: this.positionAbs + }; + } + +})); + +$.extend($.ui.draggable, { + version: "1.7", + eventPrefix: "drag", + defaults: { + addClasses: true, + appendTo: "parent", + axis: false, + cancel: ":input,option", + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + delay: 0, + distance: 1, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + } +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "iframeFix", { + start: function(event, ui) { + var o = $(this).data('draggable').options; + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + }, + stop: function(event, ui) { + $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack.group)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min); + }); + + $(group).each(function(i) { + this.style.zIndex = o.stack.min + i; + }); + + this[0].style.zIndex = o.stack.min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); Property changes on: messageforums-app/src/webapp/js/ui.draggable.js ___________________________________________________________________ Added: svn:eol-style + native Index: messageforums-app/src/webapp/js/Scroller.js =================================================================== --- messageforums-app/src/webapp/js/Scroller.js (revision 0) +++ messageforums-app/src/webapp/js/Scroller.js (revision 0) @@ -0,0 +1,132 @@ +/* +Copyright 2008-2009 University of Cambridge +Copyright 2008-2009 University of Toronto +Copyright 2007-2009 University of California, Berkeley + +Licensed under the Educational Community License (ECL), Version 2.0 or the New +BSD license. You may not use this file except in compliance with one these +Licenses. + +You may obtain a copy of the ECL 2.0 License and BSD License at +https://source.fluidproject.org/svn/LICENSE.txt +*/ + +/*global jQuery*/ +/*global fluid_1_0*/ + +fluid_1_0 = fluid_1_0 || {}; + +(function ($, fluid) { + + var refreshView = function (that) { + var maxHeight = that.options.maxHeight; + var isOverMaxHeight = (that.scrollingElm.children().eq(0).height() > maxHeight); + var setHeight = (isOverMaxHeight) ? maxHeight : ""; + that.scrollingElm.height(setHeight); + }; + + var scrollBottom = function (that) { + that.scrollingElm[0].scrollTop = that.scrollingElm[0].scrollHeight; + }; + + var scrollTo = function (that, element) { + if (!element || element.length < 1) { + return; + } + + var padTop = 0; + var padBottom = 0; + + var elmPosTop = element[0].offsetTop; + var elmHeight = element.height(); + var containerScrollTop = that.scrollingElm[0].scrollTop; + var containerHeight = that.scrollingElm.height(); + + if (that.options.padScroll) { + // if the combined height of the elements is greater than the + // viewport then then scrollTo element would not be in view + var prevElmHeight = element.prev().height(); + padTop = (prevElmHeight + elmHeight <= containerHeight) ? prevElmHeight : 0; + var nextElmHeight = element.next().height(); + padBottom = (nextElmHeight + elmHeight <= containerHeight) ? nextElmHeight : 0; + } + + // if the top of the row is ABOVE the view port move the row into position + if ((elmPosTop - padTop) < containerScrollTop) { + that.scrollingElm[0].scrollTop = elmPosTop - padTop; + } + + // if the bottom of the row is BELOW the viewport then scroll it into position + if (((elmPosTop + elmHeight) + padBottom) > (containerScrollTop + containerHeight)) { + elmHeight = (elmHeight < containerHeight) ? elmHeight : containerHeight; + that.scrollingElm[0].scrollTop = (elmPosTop - containerHeight + elmHeight + padBottom); + } + }; + + var setupScroller = function (that) { + that.scrollingElm = that.container.parents(that.options.selectors.wrapper); + + // We should render our own sensible default if the scrolling element is missing. + if (!that.scrollingElm.length) { + fluid.fail({ + name: "Missing Scroller", + message: "The scroller wrapper element was not found." + }); + } + + // set the height of the scroller unless this is IE6 + if (!$.browser.msie || $.browser.version > 6) { + that.scrollingElm.css("max-height", that.options.maxHeight); + } + }; + + /** + * Creates a new Scroller component. + * + * @param {Object} container the element containing the collection of things to make scrollable + * @param {Object} options configuration options for the component + */ + fluid.scroller = function (container, options) { + var that = fluid.initView("fluid.scroller", container, options); + setupScroller(that); + + /** + * Scrolls the specified element into view + * + * @param {jQuery} element the element to scroll into view + */ + that.scrollTo = function (element) { + scrollTo(that, element); + }; + + /** + * Scrolls to the bottom of the view. + */ + that.scrollBottom = function () { + scrollBottom(that); + }; + + /** + * Refreshes the scroller's appearance based on any changes to the document. + */ + that.refreshView = function () { + if ($.browser.msie && $.browser.version < 7) { + refreshView(that); + } + }; + + that.refreshView(); + return that; + }; + + fluid.defaults("fluid.scroller", { + selectors: { + wrapper: ".flc-scroller" + }, + + maxHeight: 180, + + padScroll: true + }); + +})(jQuery, fluid_1_0); Property changes on: messageforums-app/src/webapp/js/Scroller.js ___________________________________________________________________ Added: svn:eol-style + native Index: messageforums-app/src/webapp/js/forum.js =================================================================== --- messageforums-app/src/webapp/js/forum.js (revision 121251) +++ messageforums-app/src/webapp/js/forum.js (working copy) @@ -622,6 +622,22 @@ }); +function resizeFrameForDialog() +{ + if (top.location != self.location) { + var frame = parent.document.getElementById(window.name); + } + if( frame ) { + var clientH = document.body.clientHeight + 400; + $( frame ).height( clientH ); + } + else { + throw( "resizeFrame did not get the frame (using name=" + window.name + ")" ); + } +} + + + $(document).ready(function(){ $('.blockMe').click(function(e){ var buttonContainer = $(this).parents('.act'); Index: messageforums-app/src/webapp/js/jquery.bgiframe.js =================================================================== --- messageforums-app/src/webapp/js/jquery.bgiframe.js (revision 0) +++ messageforums-app/src/webapp/js/jquery.bgiframe.js (revision 0) @@ -0,0 +1,104 @@ +/* Copyright (c) 2006 Brandon Aaron (http://brandonaaron.net) + * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php) + * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses. + * + * $LastChangedDate: 2009-05-05 08:14:12 -0700 (Tue, 05 May 2009) $ + * $Rev: 7137 $ + * + * Version 2.1 + */ + +(function($){ + +/** + * The bgiframe is chainable and applies the iframe hack to get + * around zIndex issues in IE6. It will only apply itself in IE + * and adds a class to the iframe called 'bgiframe'. The iframe + * is appeneded as the first child of the matched element(s) + * with a tabIndex and zIndex of -1. + * + * By default the plugin will take borders, sized with pixel units, + * into account. If a different unit is used for the border's width, + * then you will need to use the top and left settings as explained below. + * + * NOTICE: This plugin has been reported to cause perfromance problems + * when used on elements that change properties (like width, height and + * opacity) a lot in IE6. Most of these problems have been caused by + * the expressions used to calculate the elements width, height and + * borders. Some have reported it is due to the opacity filter. All + * these settings can be changed if needed as explained below. + * + * @example $('div').bgiframe(); + * @before
+ * @result
+ *
+ * @param Map settings Optional settings to configure the iframe.
+ * @option String|Number top The iframe must be offset to the top
+ * by the width of the top border. This should be a negative
+ * number representing the border-top-width. If a number is
+ * is used here, pixels will be assumed. Otherwise, be sure
+ * to specify a unit. An expression could also be used.
+ * By default the value is "auto" which will use an expression
+ * to get the border-top-width if it is in pixels.
+ * @option String|Number left The iframe must be offset to the left
+ * by the width of the left border. This should be a negative
+ * number representing the border-left-width. If a number is
+ * is used here, pixels will be assumed. Otherwise, be sure
+ * to specify a unit. An expression could also be used.
+ * By default the value is "auto" which will use an expression
+ * to get the border-left-width if it is in pixels.
+ * @option String|Number width This is the width of the iframe. If
+ * a number is used here, pixels will be assume. Otherwise, be sure
+ * to specify a unit. An experssion could also be used.
+ * By default the value is "auto" which will use an experssion
+ * to get the offsetWidth.
+ * @option String|Number height This is the height of the iframe. If
+ * a number is used here, pixels will be assume. Otherwise, be sure
+ * to specify a unit. An experssion could also be used.
+ * By default the value is "auto" which will use an experssion
+ * to get the offsetHeight.
+ * @option Boolean opacity This is a boolean representing whether or not
+ * to use opacity. If set to true, the opacity of 0 is applied. If
+ * set to false, the opacity filter is not applied. Default: true.
+ * @option String src This setting is provided so that one could change
+ * the src of the iframe to whatever they need.
+ * Default: "javascript:false;"
+ *
+ * @name bgiframe
+ * @type jQuery
+ * @cat Plugins/bgiframe
+ * @author Brandon Aaron (brandon.aaron@gmail.com || http://brandonaaron.net)
+ */
+$.fn.bgIframe = $.fn.bgiframe = function(s) {
+ // This is only for IE6
+ if ( $.browser.msie && parseInt($.browser.version) <= 6 ) {
+ s = $.extend({
+ top : 'auto', // auto == .currentStyle.borderTopWidth
+ left : 'auto', // auto == .currentStyle.borderLeftWidth
+ width : 'auto', // auto == offsetWidth
+ height : 'auto', // auto == offsetHeight
+ opacity : true,
+ src : 'javascript:false;'
+ }, s || {});
+ var prop = function(n){return n&&n.constructor==Number?n+'px':n;},
+ html = '';
+ return this.each(function() {
+ if ( $('> iframe.bgiframe', this).length == 0 )
+ this.insertBefore( document.createElement(html), this.firstChild );
+ });
+ }
+ return this;
+};
+
+// Add browser.version if it doesn't exist
+if (!$.browser.version)
+ $.browser.version = navigator.userAgent.toLowerCase().match(/.+(?:rv|it|ra|ie)[\/: ]([\d.]+)/)[1];
+
+})(jQuery);
\ No newline at end of file
Property changes on: messageforums-app/src/webapp/js/jquery.bgiframe.js
___________________________________________________________________
Added: svn:eol-style
+ native
Index: messageforums-app/src/webapp/js/json2.js
===================================================================
--- messageforums-app/src/webapp/js/json2.js (revision 0)
+++ messageforums-app/src/webapp/js/json2.js (revision 0)
@@ -0,0 +1,475 @@
+/*
+ http://www.JSON.org/json2.js
+ 2009-06-18
+
+ Public Domain.
+
+ NO WARRANTY EXPRESSED OR IMPLIED. USE AT YOUR OWN RISK.
+
+ See http://www.JSON.org/js.html
+
+ This file creates a global JSON object containing two methods: stringify
+ and parse.
+
+ JSON.stringify(value, replacer, space)
+ value any JavaScript value, usually an object or array.
+
+ replacer an optional parameter that determines how object
+ values are stringified for objects. It can be a
+ function or an array of strings.
+
+ space an optional parameter that specifies the indentation
+ of nested structures. If it is omitted, the text will
+ be packed without extra whitespace. If it is a number,
+ it will specify the number of spaces to indent at each
+ level. If it is a string (such as '\t' or ' '),
+ it contains the characters used to indent at each level.
+
+ This method produces a JSON text from a JavaScript value.
+
+ When an object value is found, if the object contains a toJSON
+ method, its toJSON method will be called and the result will be
+ stringified. A toJSON method does not serialize: it returns the
+ value represented by the name/value pair that should be serialized,
+ or undefined if nothing should be serialized. The toJSON method
+ will be passed the key associated with the value, and this will be
+ bound to the object holding the key.
+
+ For example, this would serialize Dates as ISO strings.
+
+ Date.prototype.toJSON = function (key) {
+ function f(n) {
+ // Format integers to have at least two digits.
+ return n < 10 ? '0' + n : n;
+ }
+
+ return this.getUTCFullYear() + '-' +
+ f(this.getUTCMonth() + 1) + '-' +
+ f(this.getUTCDate()) + 'T' +
+ f(this.getUTCHours()) + ':' +
+ f(this.getUTCMinutes()) + ':' +
+ f(this.getUTCSeconds()) + 'Z';
+ };
+
+ You can provide an optional replacer method. It will be passed the
+ key and value of each member, with this bound to the containing
+ object. The value that is returned from your method will be
+ serialized. If your method returns undefined, then the member will
+ be excluded from the serialization.
+
+ If the replacer parameter is an array of strings, then it will be
+ used to select the members to be serialized. It filters the results
+ such that only members with keys listed in the replacer array are
+ stringified.
+
+ Values that do not have JSON representations, such as undefined or
+ functions, will not be serialized. Such values in objects will be
+ dropped; in arrays they will be replaced with null. You can use
+ a replacer function to replace those with JSON values.
+ JSON.stringify(undefined) returns undefined.
+
+ The optional space parameter produces a stringification of the
+ value that is filled with line breaks and indentation to make it
+ easier to read.
+
+ If the space parameter is a non-empty string, then that string will
+ be used for indentation. If the space parameter is a number, then
+ the indentation will be that many spaces.
+
+ Example:
+
+ text = JSON.stringify(['e', {pluribus: 'unum'}]);
+ // text is '["e",{"pluribus":"unum"}]'
+
+
+ text = JSON.stringify(['e', {pluribus: 'unum'}], null, '\t');
+ // text is '[\n\t"e",\n\t{\n\t\t"pluribus": "unum"\n\t}\n]'
+
+ text = JSON.stringify([new Date()], function (key, value) {
+ return this[key] instanceof Date ?
+ 'Date(' + this[key] + ')' : value;
+ });
+ // text is '["Date(---current time---)"]'
+
+
+ JSON.parse(text, reviver)
+ This method parses a JSON text to produce an object or array.
+ It can throw a SyntaxError exception.
+
+ The optional reviver parameter is a function that can filter and
+ transform the results. It receives each of the keys and values,
+ and its return value is used instead of the original value.
+ If it returns what it received, then the structure is not modified.
+ If it returns undefined then the member is deleted.
+
+ Example:
+
+ // Parse the text. Values that look like ISO date strings will
+ // be converted to Date objects.
+
+ myData = JSON.parse(text, function (key, value) {
+ var a;
+ if (typeof value === 'string') {
+ a =
+/^(\d{4})-(\d{2})-(\d{2})T(\d{2}):(\d{2}):(\d{2}(?:\.\d*)?)Z$/.exec(value);
+ if (a) {
+ return new Date(Date.UTC(+a[1], +a[2] - 1, +a[3], +a[4],
+ +a[5], +a[6]));
+ }
+ }
+ return value;
+ });
+
+ myData = JSON.parse('["Date(09/09/2001)"]', function (key, value) {
+ var d;
+ if (typeof value === 'string' &&
+ value.slice(0, 5) === 'Date(' &&
+ value.slice(-1) === ')') {
+ d = new Date(value.slice(5, -1));
+ if (d) {
+ return d;
+ }
+ }
+ return value;
+ });
+
+
+ This is a reference implementation. You are free to copy, modify, or
+ redistribute.
+
+ This code should be minified before deployment.
+ See http://javascript.crockford.com/jsmin.html
+
+ USE YOUR OWN COPY. IT IS EXTREMELY UNWISE TO LOAD CODE FROM SERVERS YOU DO
+ NOT CONTROL.
+*/
+
+/*jslint evil: true */
+
+/*members "", "\b", "\t", "\n", "\f", "\r", "\"", JSON, "\\", apply,
+ call, charCodeAt, getUTCDate, getUTCFullYear, getUTCHours,
+ getUTCMinutes, getUTCMonth, getUTCSeconds, hasOwnProperty, join,
+ lastIndex, length, parse, prototype, push, replace, slice, stringify,
+ test, toJSON, toString, valueOf
+*/
+
+// Create a JSON object only if one does not already exist. We create the
+// methods in a closure to avoid creating global variables.
+
+var JSON = JSON || {};
+
+(function () {
+
+ function f(n) {
+ // Format integers to have at least two digits.
+ return n < 10 ? '0' + n : n;
+ }
+
+ if (typeof Date.prototype.toJSON !== 'function') {
+
+ Date.prototype.toJSON = function (key) {
+
+ return this.valueOf() ? this.getUTCFullYear() + '-' +
+ f(this.getUTCMonth() + 1) + '-' +
+ f(this.getUTCDate()) + 'T' +
+ f(this.getUTCHours()) + ':' +
+ f(this.getUTCMinutes()) + ':' +
+ f(this.getUTCSeconds()) + 'Z' : null;
+ };
+
+ String.prototype.toJSON =
+ Number.prototype.toJSON =
+ Boolean.prototype.toJSON = function (key) {
+ return this.valueOf();
+ };
+ }
+
+ var cx = /[\u0000\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,
+ escapable = /[\\\"\x00-\x1f\x7f-\x9f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,
+ gap,
+ indent,
+ meta = { // table of character substitutions
+ '\b': '\\b',
+ '\t': '\\t',
+ '\n': '\\n',
+ '\f': '\\f',
+ '\r': '\\r',
+ '"' : '\\"',
+ '\\': '\\\\'
+ },
+ rep;
+
+
+ function quote(string) {
+
+// If the string contains no control characters, no quote characters, and no
+// backslash characters, then we can safely slap some quotes around it.
+// Otherwise we must also replace the offending characters with safe escape
+// sequences.
+
+ escapable.lastIndex = 0;
+ return escapable.test(string) ?
+ '"' + string.replace(escapable, function (a) {
+ var c = meta[a];
+ return typeof c === 'string' ? c :
+ '\\u' + ('0000' + a.charCodeAt(0).toString(16)).slice(-4);
+ }) + '"' :
+ '"' + string + '"';
+ }
+
+
+ function str(key, holder) {
+
+// Produce a string from holder[key].
+
+ var i, // The loop counter.
+ k, // The member key.
+ v, // The member value.
+ length,
+ mind = gap,
+ partial,
+ value = holder[key];
+
+// If the value has a toJSON method, call it to obtain a replacement value.
+
+ if (value && typeof value === 'object' &&
+ typeof value.toJSON === 'function') {
+ value = value.toJSON(key);
+ }
+
+// If we were called with a replacer function, then call the replacer to
+// obtain a replacement value.
+
+ if (typeof rep === 'function') {
+ value = rep.call(holder, key, value);
+ }
+
+// What happens next depends on the value's type.
+
+ switch (typeof value) {
+ case 'string':
+ return quote(value);
+
+ case 'number':
+
+// JSON numbers must be finite. Encode non-finite numbers as null.
+
+ return isFinite(value) ? String(value) : 'null';
+
+ case 'boolean':
+ case 'null':
+
+// If the value is a boolean or null, convert it to a string. Note:
+// typeof null does not produce 'null'. The case is included here in
+// the remote chance that this gets fixed someday.
+
+ return String(value);
+
+// If the type is 'object', we might be dealing with an object or an array or
+// null.
+
+ case 'object':
+
+// Due to a specification blunder in ECMAScript, typeof null is 'object',
+// so watch out for that case.
+
+ if (!value) {
+ return 'null';
+ }
+
+// Make an array to hold the partial results of stringifying this object value.
+
+ gap += indent;
+ partial = [];
+
+// Is the value an array?
+
+ if (Object.prototype.toString.apply(value) === '[object Array]') {
+
+// The value is an array. Stringify every element. Use null as a placeholder
+// for non-JSON values.
+
+ length = value.length;
+ for (i = 0; i < length; i += 1) {
+ partial[i] = str(i, value) || 'null';
+ }
+
+// Join all of the elements together, separated with commas, and wrap them in
+// brackets.
+
+ v = partial.length === 0 ? '[]' :
+ gap ? '[\n' + gap +
+ partial.join(',\n' + gap) + '\n' +
+ mind + ']' :
+ '[' + partial.join(',') + ']';
+ gap = mind;
+ return v;
+ }
+
+// If the replacer is an array, use it to select the members to be stringified.
+
+ if (rep && typeof rep === 'object') {
+ length = rep.length;
+ for (i = 0; i < length; i += 1) {
+ k = rep[i];
+ if (typeof k === 'string') {
+ v = str(k, value);
+ if (v) {
+ partial.push(quote(k) + (gap ? ': ' : ':') + v);
+ }
+ }
+ }
+ } else {
+
+// Otherwise, iterate through all of the keys in the object.
+
+ for (k in value) {
+ if (Object.hasOwnProperty.call(value, k)) {
+ v = str(k, value);
+ if (v) {
+ partial.push(quote(k) + (gap ? ': ' : ':') + v);
+ }
+ }
+ }
+ }
+
+// Join all of the member texts together, separated with commas,
+// and wrap them in braces.
+
+ v = partial.length === 0 ? '{}' :
+ gap ? '{\n' + gap + partial.join(',\n' + gap) + '\n' +
+ mind + '}' : '{' + partial.join(',') + '}';
+ gap = mind;
+ return v;
+ }
+ }
+
+// If the JSON object does not yet have a stringify method, give it one.
+
+ if (typeof JSON.stringify !== 'function') {
+ JSON.stringify = function (value, replacer, space) {
+
+// The stringify method takes a value and an optional replacer, and an optional
+// space parameter, and returns a JSON text. The replacer can be a function
+// that can replace values, or an array of strings that will select the keys.
+// A default replacer method can be provided. Use of the space parameter can
+// produce text that is more easily readable.
+
+ var i;
+ gap = '';
+ indent = '';
+
+// If the space parameter is a number, make an indent string containing that
+// many spaces.
+
+ if (typeof space === 'number') {
+ for (i = 0; i < space; i += 1) {
+ indent += ' ';
+ }
+
+// If the space parameter is a string, it will be used as the indent string.
+
+ } else if (typeof space === 'string') {
+ indent = space;
+ }
+
+// If there is a replacer, it must be a function or an array.
+// Otherwise, throw an error.
+
+ rep = replacer;
+ if (replacer && typeof replacer !== 'function' &&
+ (typeof replacer !== 'object' ||
+ typeof replacer.length !== 'number')) {
+ throw new Error('JSON.stringify');
+ }
+
+// Make a fake root object containing our value under the key of ''.
+// Return the result of stringifying the value.
+
+ return str('', {'': value});
+ };
+ }
+
+
+// If the JSON object does not yet have a parse method, give it one.
+
+ if (typeof JSON.parse !== 'function') {
+ JSON.parse = function (text, reviver) {
+
+// The parse method takes a text and an optional reviver function, and returns
+// a JavaScript value if the text is a valid JSON text.
+
+ var j;
+
+ function walk(holder, key) {
+
+// The walk method is used to recursively walk the resulting structure so
+// that modifications can be made.
+
+ var k, v, value = holder[key];
+ if (value && typeof value === 'object') {
+ for (k in value) {
+ if (Object.hasOwnProperty.call(value, k)) {
+ v = walk(value, k);
+ if (v !== undefined) {
+ value[k] = v;
+ } else {
+ delete value[k];
+ }
+ }
+ }
+ }
+ return reviver.call(holder, key, value);
+ }
+
+
+// Parsing happens in four stages. In the first stage, we replace certain
+// Unicode characters with escape sequences. JavaScript handles many characters
+// incorrectly, either silently deleting them, or treating them as line endings.
+
+ cx.lastIndex = 0;
+ if (cx.test(text)) {
+ text = text.replace(cx, function (a) {
+ return '\\u' +
+ ('0000' + a.charCodeAt(0).toString(16)).slice(-4);
+ });
+ }
+
+// In the second stage, we run the text against regular expressions that look
+// for non-JSON patterns. We are especially concerned with '()' and 'new'
+// because they can cause invocation, and '=' because it can cause mutation.
+// But just to be safe, we want to reject all unexpected forms.
+
+// We split the second stage into 4 regexp operations in order to work around
+// crippling inefficiencies in IE's and Safari's regexp engines. First we
+// replace the JSON backslash pairs with '@' (a non-JSON character). Second, we
+// replace all simple value tokens with ']' characters. Third, we delete all
+// open brackets that follow a colon or comma or that begin the text. Finally,
+// we look to see that the remaining characters are only whitespace or ']' or
+// ',' or ':' or '{' or '}'. If that is so, then the text is safe for eval.
+
+ if (/^[\],:{}\s]*$/.
+test(text.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g, '@').
+replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g, ']').
+replace(/(?:^|:|,)(?:\s*\[)+/g, ''))) {
+
+// In the third stage we use the eval function to compile the text into a
+// JavaScript structure. The '{' operator is subject to a syntactic ambiguity
+// in JavaScript: it can begin a block or an object literal. We wrap the text
+// in parens to eliminate the ambiguity.
+
+ j = eval('(' + text + ')');
+
+// In the optional fourth stage, we recursively walk the new structure, passing
+// each name/value pair to a reviver function for possible transformation.
+
+ return typeof reviver === 'function' ?
+ walk({'': j}, '') : j;
+ }
+
+// If the text is not JSON parseable, then a SyntaxError is thrown.
+
+ throw new SyntaxError('JSON.parse');
+ };
+ }
+}());
Property changes on: messageforums-app/src/webapp/js/json2.js
___________________________________________________________________
Added: svn:eol-style
+ native
Index: messageforums-app/src/webapp/js/fluidframework-min.js
===================================================================
--- messageforums-app/src/webapp/js/fluidframework-min.js (revision 0)
+++ messageforums-app/src/webapp/js/fluidframework-min.js (revision 0)
@@ -0,0 +1,2168 @@
+/*
+Copyright 2008-2009 University of Cambridge
+Copyright 2008-2009 University of Toronto
+Copyright 2007-2009 University of California, Berkeley
+
+Licensed under the Educational Community License (ECL), Version 2.0 or the New
+BSD license. You may not use this file except in compliance with one these
+Licenses.
+
+You may obtain a copy of the ECL 2.0 License and BSD License at
+https://source.fluidproject.org/svn/LICENSE.txt
+*/
+
+// Declare dependencies.
+/*global jQuery, YAHOO, opera*/
+
+var fluid_1_0 = fluid_1_0 || {};
+var fluid = fluid || fluid_1_0;
+
+(function ($, fluid) {
+
+ fluid.version = "Infusion 1.0";
+
+ /**
+ * Causes an error message to be logged to the console and a real runtime error to be thrown.
+ *
+ * @param {String|Error} message the error message to log
+ */
+ fluid.fail = function (message) {
+ fluid.setLogging(true);
+ fluid.log(message.message? message.message : message);
+ throw new Error(message);
+ //message.fail(); // Intentionally cause a browser error by invoking a nonexistent function.
+ };
+
+ /**
+ * Wraps an object in a jQuery if it isn't already one. This function is useful since
+ * it ensures to wrap a null or otherwise falsy argument to itself, rather than the
+ * often unhelpful jQuery default of returning the overall document node.
+ *
+ * @param {Object} obj the object to wrap in a jQuery
+ */
+ fluid.wrap = function (obj) {
+ return ((!obj || obj.jquery) ? obj : $(obj));
+ };
+
+ /**
+ * If obj is a jQuery, this function will return the first DOM element within it.
+ *
+ * @param {jQuery} obj the jQuery instance to unwrap into a pure DOM element
+ */
+ fluid.unwrap = function (obj) {
+ return obj && obj.jquery && obj.length === 1 ? obj[0] : obj; // Unwrap the element if it's a jQuery.
+ };
+
+ /**
+ * Searches through the supplied object for the first value which matches the one supplied.
+ * @param obj {Object} the Object to be searched through
+ * @param value {Object} the value to be found. This will be compared against the object's
+ * member using === equality.
+ * @return {String} The first key whose value matches the one supplied, or
+
+
+
+
+
+
+
+
+
+
+
+ 
+
+
+ <%--********************* Attachment *********************--%>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
"; + }); + + $(".threads-to-move", container).html(itemHTML); + } + + var buildSourceListScroller = function () { + var itemHTML = ""; + var topics= getJSONData("topics").topics; + var totalTopics= topics.length; + for (var j = 0; j < totalTopics; j++) { + var sourcetitle = $(".sourcetitle").text(); + var currtopic = topics[j].topictitle ; + if ( sourcetitle == currtopic) { + // if current topic, greyed out disable radio selection + itemHTML += makeSourceListItemDisabled(topics[j]); + } + else { + itemHTML += makeSourceListItem(topics[j]); + } + } + $(sourceList).html(itemHTML); +/* + if (window.parent.recipientData) { + restoreSourceListSettings(); + } +*/ + $(".topic-source-total, .topic-source-counter", container).text(totalTopics); + }; + + /* KEYBOARD NAVIGATION + */ + + var moveThreadEnabled = function (){ + //function to check total number of CheckBoxes that are checked in a form + //initialize total count to zero + var totalChecked = 0; + //get total number of CheckBoxes in form + if (typeof document.forms['msgForum'].moveCheckbox.length === 'undefined') { + /*when there is just one checkbox moveCheckbox is not an array, document.forms['msgForum'].moveCheckbox.length returns undefined */ + if (document.forms['msgForum'].moveCheckbox.checked == true ) + { + totalChecked += 1; + } + } + else { + // more than one checkbox is checked. + var chkBoxCount = document.forms['msgForum'].moveCheckbox.length; + //loop through each CheckBox + for (var i = 0; i < chkBoxCount; i++) + { + //check the state of each CheckBox + if (eval("document.forms['msgForum'].moveCheckbox[" + i + "].checked") == true) + { + //it's checked so increment the counter + totalChecked += 1; + } + } + } + if (totalChecked >0){ + // enable the move link + return true; + } + else { + return false; + } + + } + + /* SETUP DOM EVENTS */ + + var bindDOMelements = function () { + + $(".topic-btn-save").click(function () { + // call processMoveThread + var linkid = "msgForum:hidden_move_message_commandLink"; + var hiddenmovelink = document.getElementById(linkid); + hiddenmovelink.onclick(); +// $(".topic-picker").dialog("close"); + }); + + $("#searchTopic").keyup(function (event) { + if (event.keyCode === $.ui.keyCode.ESCAPE || $(this).val() === "") { + //if esc is pressed we want to clear the value of search box + $(this).val(""); + filterList(); + } else { + searchByName(); + } + }); + + $(".checkbox-reminder").click(function () { + var reminder = $("#checkbox-reminder:checked").val(); + if (reminder != undefined) { + // reminder checkbox is checked + $(".moveReminder").val(true); + } + else { + // reminder checkbox is NOT checked + $(".moveReminder").val(false); + } + }); + + $(".topic-btn-cancel").click(function () { + $(".topic-picker").dialog("close"); + }); + + $('input:radio',sourceList).click(function () { + var radiovalue = $(this).val(); + // enable Move Threads button + $(".topic-btn-save").removeAttr("disabled"); + var topichidden = $(".selectedTopicid"); + $(".selectedTopicid").val(radiovalue); + }); + + $(sourceList).click(function (event) { + var elm = ($(event.target).is('div')) ? $(event.target) : $(event.target).parent("div"); + // addSingleRow(elm); + }); + + $(".forumDropdown").change(function () { + filterList(); + }); + + $(".display-topic-picker").click(function () { + if (moveThreadEnabled()) { + buildThreadList(); + //buildSourceListScroller(); + $(".topic-picker").dialog("open"); + //saveRestorePoint(); + } + else { + // do nothing + } + }); + + }; + + /* Initialization Routine */ + + var parseData = function () { + var txtData = $("#data").text(); + jsonData = JSON.parse(txtData, null); + }; + + var collectElements = function () { + container = $("#topic-picker"); + forumFilterSelect = $(".forumDropdown", container); + sourceList = $(".topic-source-list", container); + sourceStructure = $(".topic-source", container); + }; + + var initDialog = function () { + $.ui.dialog.defaults.bgiframe = true; + $(".topic-picker").dialog({ autoOpen: false, width: 660, modal: true, position: 'top'}); + }; + + $(function () { + window.parent.scrollTo(0,0); + parseData(); + collectElements(); + initDialog(); + sourceListScroller = fluid.scroller($(".topic-source-scroller-inner"), { maxHeight: 270}); + //buildThreadList(); + buildSourceListScroller(); + buildForumSelect(); + $(".forumDropdown").val("select-forum"); + filterList(); + bindDOMelements(); + // stripeList(sourceList); + }); + +})(jQuery, fluid_1_0); Property changes on: messageforums-app/src/webapp/js/forum_movethread.js ___________________________________________________________________ Added: svn:eol-style + native Index: messageforums-app/src/webapp/js/ui.dialog.js =================================================================== --- messageforums-app/src/webapp/js/ui.dialog.js (revision 0) +++ messageforums-app/src/webapp/js/ui.dialog.js (revision 0) @@ -0,0 +1,650 @@ +/* + * jQuery UI Dialog 1.7 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * ui.core.js + * ui.draggable.js + * ui.resizable.js + */ +(function($) { + +var setDataSwitch = { + dragStart: "start.draggable", + drag: "drag.draggable", + dragStop: "stop.draggable", + maxHeight: "maxHeight.resizable", + minHeight: "minHeight.resizable", + maxWidth: "maxWidth.resizable", + minWidth: "minWidth.resizable", + resizeStart: "start.resizable", + resize: "drag.resizable", + resizeStop: "stop.resizable" + }, + + uiDialogClasses = + 'ui-dialog ' + + 'ui-widget ' + + 'ui-widget-content ' + + 'ui-corner-all '; + +$.widget("ui.dialog", { + + _init: function() { + this.originalTitle = this.element.attr('title'); + + var self = this, + options = this.options, + + title = options.title || this.originalTitle || ' ', + titleId = $.ui.dialog.getTitleId(this.element), + + uiDialog = (this.uiDialog = $('')) + .appendTo(document.body) + .hide() + .addClass(uiDialogClasses + options.dialogClass) + .css({ + position: 'absolute', + overflow: 'hidden', + zIndex: options.zIndex + }) + // setting tabIndex makes the div focusable + // setting outline to 0 prevents a border on focus in Mozilla + .attr('tabIndex', -1).css('outline', 0).keydown(function(event) { + (options.closeOnEscape && event.keyCode + && event.keyCode == $.ui.keyCode.ESCAPE && self.close(event)); + }) + .attr({ + role: 'dialog', + 'aria-labelledby': titleId + }) + .mousedown(function(event) { + self.moveToTop(false, event); + }), + + uiDialogContent = this.element + .show() + .removeAttr('title') + .addClass( + 'ui-dialog-content ' + + 'ui-widget-content') + .appendTo(uiDialog), + + uiDialogTitlebar = (this.uiDialogTitlebar = $('')) + .addClass( + 'ui-dialog-titlebar ' + + 'ui-widget-header ' + + 'ui-corner-all ' + + 'ui-helper-clearfix' + ) + .prependTo(uiDialog), + + uiDialogTitlebarClose = $('') + .addClass( + 'ui-dialog-titlebar-close ' + + 'ui-corner-all' + ) + .attr('role', 'button') + .hover( + function() { + uiDialogTitlebarClose.addClass('ui-state-hover'); + }, + function() { + uiDialogTitlebarClose.removeClass('ui-state-hover'); + } + ) + .focus(function() { + uiDialogTitlebarClose.addClass('ui-state-focus'); + }) + .blur(function() { + uiDialogTitlebarClose.removeClass('ui-state-focus'); + }) + .mousedown(function(ev) { + ev.stopPropagation(); + }) + .click(function(event) { + self.close(event); + return false; + }) + .appendTo(uiDialogTitlebar), + + uiDialogTitlebarCloseText = (this.uiDialogTitlebarCloseText = $('')) + .addClass( + 'ui-icon ' + + 'ui-icon-closethick' + ) + .text(options.closeText) + .appendTo(uiDialogTitlebarClose), + + uiDialogTitle = $('') + .addClass('ui-dialog-title') + .attr('id', titleId) + .html(title) + .prependTo(uiDialogTitlebar); + + uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection(); + + (options.draggable && $.fn.draggable && this._makeDraggable()); + (options.resizable && $.fn.resizable && this._makeResizable()); + + this._createButtons(options.buttons); + this._isOpen = false; + + (options.bgiframe && $.fn.bgiframe && uiDialog.bgiframe()); + (options.autoOpen && this.open()); + + }, + + destroy: function() { + (this.overlay && this.overlay.destroy()); + this.uiDialog.hide(); + this.element + .unbind('.dialog') + .removeData('dialog') + .removeClass('ui-dialog-content ui-widget-content') + .hide().appendTo('body'); + this.uiDialog.remove(); + + (this.originalTitle && this.element.attr('title', this.originalTitle)); + }, + + close: function(event) { + var self = this; + + if (false === self._trigger('beforeclose', event)) { + return; + } + + (self.overlay && self.overlay.destroy()); + self.uiDialog.unbind('keypress.ui-dialog'); + + (self.options.hide + ? self.uiDialog.hide(self.options.hide, function() { + self._trigger('close', event); + }) + : self.uiDialog.hide() && self._trigger('close', event)); + + $.ui.dialog.overlay.resize(); + + self._isOpen = false; + }, + + isOpen: function() { + return this._isOpen; + }, + + // the force parameter allows us to move modal dialogs to their correct + // position on open + moveToTop: function(force, event) { + + if ((this.options.modal && !force) + || (!this.options.stack && !this.options.modal)) { + return this._trigger('focus', event); + } + + if (this.options.zIndex > $.ui.dialog.maxZ) { + $.ui.dialog.maxZ = this.options.zIndex; + } + (this.overlay && this.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ)); + + //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed. + // http://ui.jquery.com/bugs/ticket/3193 + var saveScroll = { scrollTop: this.element.attr('scrollTop'), scrollLeft: this.element.attr('scrollLeft') }; + this.uiDialog.css('z-index', ++$.ui.dialog.maxZ); + this.element.attr(saveScroll); + this._trigger('focus', event); + }, + + open: function() { + if (this._isOpen) { return; } + + var options = this.options, + uiDialog = this.uiDialog; + + this.overlay = options.modal ? new $.ui.dialog.overlay(this) : null; + (uiDialog.next().length && uiDialog.appendTo('body')); + this._size(); + this._position(options.position); + uiDialog.show(options.show); + this.moveToTop(true); + + // prevent tabbing out of modal dialogs + (options.modal && uiDialog.bind('keypress.ui-dialog', function(event) { + if (event.keyCode != $.ui.keyCode.TAB) { + return; + } + + var tabbables = $(':tabbable', this), + first = tabbables.filter(':first')[0], + last = tabbables.filter(':last')[0]; + + if (event.target == last && !event.shiftKey) { + setTimeout(function() { + first.focus(); + }, 1); + } else if (event.target == first && event.shiftKey) { + setTimeout(function() { + last.focus(); + }, 1); + } + })); + + // set focus to the first tabbable element in the content area or the first button + // if there are no tabbable elements, set focus on the dialog itself + $([]) + .add(uiDialog.find('.ui-dialog-content :tabbable:first')) + .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first')) + .add(uiDialog) + .filter(':first') + .focus(); + + this._trigger('open'); + this._isOpen = true; + }, + + _createButtons: function(buttons) { + var self = this, + hasButtons = false, + uiDialogButtonPane = $('') + .addClass( + 'ui-dialog-buttonpane ' + + 'ui-widget-content ' + + 'ui-helper-clearfix' + ); + + // if we already have a button pane, remove it + this.uiDialog.find('.ui-dialog-buttonpane').remove(); + + (typeof buttons == 'object' && buttons !== null && + $.each(buttons, function() { return !(hasButtons = true); })); + if (hasButtons) { + $.each(buttons, function(name, fn) { + $('') + .addClass( + 'ui-state-default ' + + 'ui-corner-all' + ) + .text(name) + .click(function() { fn.apply(self.element[0], arguments); }) + .hover( + function() { + $(this).addClass('ui-state-hover'); + }, + function() { + $(this).removeClass('ui-state-hover'); + } + ) + .focus(function() { + $(this).addClass('ui-state-focus'); + }) + .blur(function() { + $(this).removeClass('ui-state-focus'); + }) + .appendTo(uiDialogButtonPane); + }); + uiDialogButtonPane.appendTo(this.uiDialog); + } + }, + + _makeDraggable: function() { + var self = this, + options = this.options, + heightBeforeDrag; + + this.uiDialog.draggable({ + cancel: '.ui-dialog-content', + handle: '.ui-dialog-titlebar', + containment: 'document', + start: function() { + heightBeforeDrag = options.height; + $(this).height($(this).height()).addClass("ui-dialog-dragging"); + (options.dragStart && options.dragStart.apply(self.element[0], arguments)); + }, + drag: function() { + (options.drag && options.drag.apply(self.element[0], arguments)); + }, + stop: function() { + $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag); + (options.dragStop && options.dragStop.apply(self.element[0], arguments)); + $.ui.dialog.overlay.resize(); + } + }); + }, + + _makeResizable: function(handles) { + handles = (handles === undefined ? this.options.resizable : handles); + var self = this, + options = this.options, + resizeHandles = typeof handles == 'string' + ? handles + : 'n,e,s,w,se,sw,ne,nw'; + + this.uiDialog.resizable({ + cancel: '.ui-dialog-content', + alsoResize: this.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: options.minHeight, + start: function() { + $(this).addClass("ui-dialog-resizing"); + (options.resizeStart && options.resizeStart.apply(self.element[0], arguments)); + }, + resize: function() { + (options.resize && options.resize.apply(self.element[0], arguments)); + }, + handles: resizeHandles, + stop: function() { + $(this).removeClass("ui-dialog-resizing"); + options.height = $(this).height(); + options.width = $(this).width(); + (options.resizeStop && options.resizeStop.apply(self.element[0], arguments)); + $.ui.dialog.overlay.resize(); + } + }) + .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se'); + }, + + _position: function(pos) { + var wnd = $(window), doc = $(document), + pTop = doc.scrollTop(), pLeft = doc.scrollLeft(), + minTop = pTop; + + if ($.inArray(pos, ['center','top','right','bottom','left']) >= 0) { + pos = [ + pos == 'right' || pos == 'left' ? pos : 'center', + pos == 'top' || pos == 'bottom' ? pos : 'middle' + ]; + } + if (pos.constructor != Array) { + pos = ['center', 'middle']; + } + if (pos[0].constructor == Number) { + pLeft += pos[0]; + } else { + switch (pos[0]) { + case 'left': + pLeft += 0; + break; + case 'right': + pLeft += wnd.width() - this.uiDialog.outerWidth(); + break; + default: + case 'center': + pLeft += (wnd.width() - this.uiDialog.outerWidth()) / 2; + } + } + if (pos[1].constructor == Number) { + pTop += pos[1]; + } else { + switch (pos[1]) { + case 'top': + pTop += 0; + break; + case 'bottom': + pTop += wnd.height() - this.uiDialog.outerHeight(); + break; + default: + case 'middle': + pTop += (wnd.height() - this.uiDialog.outerHeight()) / 2; + } + } + + // prevent the dialog from being too high (make sure the titlebar + // is accessible) + pTop = Math.max(pTop, minTop); + this.uiDialog.css({top: pTop, left: pLeft}); + }, + + _setData: function(key, value){ + (setDataSwitch[key] && this.uiDialog.data(setDataSwitch[key], value)); + switch (key) { + case "buttons": + this._createButtons(value); + break; + case "closeText": + this.uiDialogTitlebarCloseText.text(value); + break; + case "dialogClass": + this.uiDialog + .removeClass(this.options.dialogClass) + .addClass(uiDialogClasses + value); + break; + case "draggable": + (value + ? this._makeDraggable() + : this.uiDialog.draggable('destroy')); + break; + case "height": + this.uiDialog.height(value); + break; + case "position": + this._position(value); + break; + case "resizable": + var uiDialog = this.uiDialog, + isResizable = this.uiDialog.is(':data(resizable)'); + + // currently resizable, becoming non-resizable + (isResizable && !value && uiDialog.resizable('destroy')); + + // currently resizable, changing handles + (isResizable && typeof value == 'string' && + uiDialog.resizable('option', 'handles', value)); + + // currently non-resizable, becoming resizable + (isResizable || this._makeResizable(value)); + break; + case "title": + $(".ui-dialog-title", this.uiDialogTitlebar).html(value || ' '); + break; + case "width": + this.uiDialog.width(value); + break; + } + + $.widget.prototype._setData.apply(this, arguments); + }, + + _size: function() { + /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + * divs will both have width and height set, so we need to reset them + */ + var options = this.options; + + // reset content sizing + this.element.css({ + height: 0, + minHeight: 0, + width: 'auto' + }); + + // reset wrapper sizing + // determine the height of all the non-content elements + var nonContentHeight = this.uiDialog.css({ + height: 'auto', + width: options.width + }) + .height(); + + this.element + .css({ + minHeight: Math.max(options.minHeight - nonContentHeight, 0), + height: options.height == 'auto' + ? 'auto' + : Math.max(options.height - nonContentHeight, 0) + }); + } +}); + +$.extend($.ui.dialog, { + version: "1.7", + defaults: { + autoOpen: true, + bgiframe: false, + buttons: {}, + closeOnEscape: true, + closeText: 'close', + dialogClass: '', + draggable: true, + hide: null, + height: 'auto', + maxHeight: false, + maxWidth: false, + minHeight: 150, + minWidth: 150, + modal: false, + position: 'center', + resizable: true, + show: null, + stack: true, + title: '', + width: 300, + zIndex: 1000 + }, + + getter: 'isOpen', + + uuid: 0, + maxZ: 0, + + getTitleId: function($el) { + return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid); + }, + + overlay: function(dialog) { + this.$el = $.ui.dialog.overlay.create(dialog); + } +}); + +$.extend($.ui.dialog.overlay, { + instances: [], + maxZ: 0, + events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','), + function(event) { return event + '.dialog-overlay'; }).join(' '), + create: function(dialog) { + if (this.instances.length === 0) { + // prevent use of anchors and inputs + // we use a setTimeout in case the overlay is created from an + // event that we're going to be cancelling (see #2804) + setTimeout(function() { + $(document).bind($.ui.dialog.overlay.events, function(event) { + var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0; + return (dialogZ > $.ui.dialog.overlay.maxZ); + }); + }, 1); + + // allow closing by pressing the escape key + $(document).bind('keydown.dialog-overlay', function(event) { + (dialog.options.closeOnEscape && event.keyCode + && event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event)); + }); + + // handle window resize + $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize); + } + + var $el = $('').appendTo(document.body) + .addClass('ui-widget-overlay').css({ + width: this.width(), + height: this.height() + }); + + (dialog.options.bgiframe && $.fn.bgiframe && $el.bgiframe()); + + this.instances.push($el); + return $el; + }, + + destroy: function($el) { + this.instances.splice($.inArray(this.instances, $el), 1); + + if (this.instances.length === 0) { + $([document, window]).unbind('.dialog-overlay'); + } + + $el.remove(); + }, + + height: function() { + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + var scrollHeight = Math.max( + document.documentElement.scrollHeight, + document.body.scrollHeight + ); + var offsetHeight = Math.max( + document.documentElement.offsetHeight, + document.body.offsetHeight + ); + + if (scrollHeight < offsetHeight) { + return $(window).height() + 'px'; + } else { + return scrollHeight + 'px'; + } + // handle "good" browsers + } else { + return $(document).height() + 'px'; + } + }, + + width: function() { + // handle IE 6 + if ($.browser.msie && $.browser.version < 7) { + var scrollWidth = Math.max( + document.documentElement.scrollWidth, + document.body.scrollWidth + ); + var offsetWidth = Math.max( + document.documentElement.offsetWidth, + document.body.offsetWidth + ); + + if (scrollWidth < offsetWidth) { + return $(window).width() + 'px'; + } else { + return scrollWidth + 'px'; + } + // handle "good" browsers + } else { + return $(document).width() + 'px'; + } + }, + + resize: function() { + /* If the dialog is draggable and the user drags it past the + * right edge of the window, the document becomes wider so we + * need to stretch the overlay. If the user then drags the + * dialog back to the left, the document will become narrower, + * so we need to shrink the overlay to the appropriate size. + * This is handled by shrinking the overlay before setting it + * to the full document size. + */ + var $overlays = $([]); + $.each($.ui.dialog.overlay.instances, function() { + $overlays = $overlays.add(this); + }); + + $overlays.css({ + width: 0, + height: 0 + }).css({ + width: $.ui.dialog.overlay.width(), + height: $.ui.dialog.overlay.height() + }); + } +}); + +$.extend($.ui.dialog.overlay.prototype, { + destroy: function() { + $.ui.dialog.overlay.destroy(this.$el); + } +}); + +})(jQuery); Property changes on: messageforums-app/src/webapp/js/ui.dialog.js ___________________________________________________________________ Added: svn:eol-style + native Index: messageforums-app/src/webapp/js/ui.draggable.js =================================================================== --- messageforums-app/src/webapp/js/ui.draggable.js (revision 0) +++ messageforums-app/src/webapp/js/ui.draggable.js (revision 0) @@ -0,0 +1,766 @@ +/* + * jQuery UI Draggable 1.7 + * + * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT (MIT-LICENSE.txt) + * and GPL (GPL-LICENSE.txt) licenses. + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * ui.core.js + */ +(function($) { + +$.widget("ui.draggable", $.extend({}, $.ui.mouse, { + + _init: function() { + + if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position"))) + this.element[0].style.position = 'relative'; + + (this.options.addClasses && this.element.addClass("ui-draggable")); + (this.options.disabled && this.element.addClass("ui-draggable-disabled")); + + this._mouseInit(); + + }, + + destroy: function() { + if(!this.element.data('draggable')) return; + this.element + .removeData("draggable") + .unbind(".draggable") + .removeClass("ui-draggable" + + " ui-draggable-dragging" + + " ui-draggable-disabled"); + this._mouseDestroy(); + }, + + _mouseCapture: function(event) { + + var o = this.options; + + if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle')) + return false; + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) + return false; + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) + $.ui.ddmanager.current = this; + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied + if(o.cursorAt) + this._adjustOffsetFromHelper(o.cursorAt); + + //Set a containment if given in the options + if(o.containment) + this._setContainment(); + + //Call plugins and callbacks + this._trigger("start", event); + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(this, event); + + this.helper.addClass("ui-draggable-dragging"); + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + this._trigger('drag', event, ui); + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px'; + if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px'; + if($.ui.ddmanager) $.ui.ddmanager.drag(this, event); + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) + dropped = $.ui.ddmanager.drop(this, event); + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + var self = this; + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + self._trigger("stop", event); + self._clear(); + }); + } else { + this._trigger("stop", event); + this._clear(); + } + + return false; + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .andSelf() + .each(function() { + if(this == event.target) handle = true; + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options; + var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element); + + if(!helper.parents('body').length) + helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo)); + + if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) + helper.css("position", "absolute"); + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if(obj.left != undefined) this.offset.click.left = obj.left + this.margins.left; + if(obj.right != undefined) this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + if(obj.top != undefined) this.offset.click.top = obj.top + this.margins.top; + if(obj.bottom != undefined) this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information + || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix + po = { top: 0, left: 0 }; + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition == "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var o = this.options; + if(o.containment == 'parent') o.containment = this.helper[0].parentNode; + if(o.containment == 'document' || o.containment == 'window') this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) { + var ce = $(o.containment)[0]; if(!ce) return; + var co = $(o.containment).offset(); + var over = ($(ce).css("overflow") != 'hidden'); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } else if(o.containment.constructor == Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) pos = this.position; + var mod = d == "absolute" ? 1 : -1; + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top // The absolute mouse position + + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left // The absolute mouse position + + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent + + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border) + - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + var pageX = event.pageX; + var pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left; + if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top; + if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left; + if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top; + } + + if(o.grid) { + var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY // The absolute mouse position + - this.offset.click.top // Click offset (relative to the element) + - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.top // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX // The absolute mouse position + - this.offset.click.left // Click offset (relative to the element) + - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent + - this.offset.parent.left // The offsetParent's offset without borders (offset + border) + + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove(); + //if($.ui.ddmanager) $.ui.ddmanager.current = null; + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins + return $.widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function(event) { + return { + helper: this.helper, + position: this.position, + absolutePosition: this.positionAbs, //deprecated + offset: this.positionAbs + }; + } + +})); + +$.extend($.ui.draggable, { + version: "1.7", + eventPrefix: "drag", + defaults: { + addClasses: true, + appendTo: "parent", + axis: false, + cancel: ":input,option", + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + delay: 0, + distance: 1, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false + } +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, 'sortable'); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid' + if(this.shouldRevert) this.instance.options.revert = true; + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper == 'original') + this.instance.currentItem.css({ top: 'auto', left: 'auto' }); + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), self = this; + + var checkPos = function(o) { + var dyClick = this.offset.click.top, dxClick = this.offset.click.left; + var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left; + var itemHeight = o.height, itemWidth = o.width; + var itemTop = o.top, itemLeft = o.left; + + return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth); + }; + + $.each(inst.sortables, function(i) { + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) this.instance._mouseDrag(event); + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger('out', event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) this.instance.placeholder.remove(); + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + }; + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function(event, ui) { + var t = $('body'), o = $(this).data('draggable').options; + if (t.css("cursor")) o._cursor = t.css("cursor"); + t.css("cursor", o.cursor); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if (o._cursor) $('body').css("cursor", o._cursor); + } +}); + +$.ui.plugin.add("draggable", "iframeFix", { + start: function(event, ui) { + var o = $(this).data('draggable').options; + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $('') + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + }, + stop: function(event, ui) { + $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data('draggable').options; + if(t.css("opacity")) o._opacity = t.css("opacity"); + t.css('opacity', o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data('draggable').options; + if(o._opacity) $(ui.helper).css('opacity', o._opacity); + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function(event, ui) { + var i = $(this).data("draggable"); + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset(); + }, + drag: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') { + + if(!o.axis || o.axis != 'x') { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if(!o.axis || o.axis != 'y') { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(!o.axis || o.axis != 'x') { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(!o.axis || o.axis != 'y') { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) + $.ui.ddmanager.prepareOffsets(i, event); + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function(event, ui) { + + var i = $(this).data("draggable"), o = i.options; + i.snapElements = []; + + $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() { + var $t = $(this); var $o = $t.offset(); + if(this != i.element[0]) i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("draggable"), o = inst.options; + var d = o.snapTolerance; + + var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (var i = inst.snapElements.length - 1; i >= 0; i--){ + + var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width, + t = inst.snapElements[i].top, b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode != 'inner') { + var ts = Math.abs(t - y2) <= d; + var bs = Math.abs(b - y1) <= d; + var ls = Math.abs(l - x2) <= d; + var rs = Math.abs(r - x1) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + + var first = (ts || bs || ls || rs); + + if(o.snapMode != 'outer') { + var ts = Math.abs(t - y1) <= d; + var bs = Math.abs(b - y2) <= d; + var ls = Math.abs(l - x1) <= d; + var rs = Math.abs(r - x2) <= d; + if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + }; + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function(event, ui) { + + var o = $(this).data("draggable").options; + + var group = $.makeArray($(o.stack.group)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || o.stack.min) - (parseInt($(b).css("zIndex"),10) || o.stack.min); + }); + + $(group).each(function(i) { + this.style.zIndex = o.stack.min + i; + }); + + this[0].style.zIndex = o.stack.min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("draggable").options; + if(t.css("zIndex")) o._zIndex = t.css("zIndex"); + t.css('zIndex', o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("draggable").options; + if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex); + } +}); + +})(jQuery); Property changes on: messageforums-app/src/webapp/js/ui.draggable.js ___________________________________________________________________ Added: svn:eol-style + native Index: messageforums-app/src/webapp/js/Scroller.js =================================================================== --- messageforums-app/src/webapp/js/Scroller.js (revision 0) +++ messageforums-app/src/webapp/js/Scroller.js (revision 0) @@ -0,0 +1,132 @@ +/* +Copyright 2008-2009 University of Cambridge +Copyright 2008-2009 University of Toronto +Copyright 2007-2009 University of California, Berkeley + +Licensed under the Educational Community License (ECL), Version 2.0 or the New +BSD license. You may not use this file except in compliance with one these +Licenses. + +You may obtain a copy of the ECL 2.0 License and BSD License at +https://source.fluidproject.org/svn/LICENSE.txt +*/ + +/*global jQuery*/ +/*global fluid_1_0*/ + +fluid_1_0 = fluid_1_0 || {}; + +(function ($, fluid) { + + var refreshView = function (that) { + var maxHeight = that.options.maxHeight; + var isOverMaxHeight = (that.scrollingElm.children().eq(0).height() > maxHeight); + var setHeight = (isOverMaxHeight) ? maxHeight : ""; + that.scrollingElm.height(setHeight); + }; + + var scrollBottom = function (that) { + that.scrollingElm[0].scrollTop = that.scrollingElm[0].scrollHeight; + }; + + var scrollTo = function (that, element) { + if (!element || element.length < 1) { + return; + } + + var padTop = 0; + var padBottom = 0; + + var elmPosTop = element[0].offsetTop; + var elmHeight = element.height(); + var containerScrollTop = that.scrollingElm[0].scrollTop; + var containerHeight = that.scrollingElm.height(); + + if (that.options.padScroll) { + // if the combined height of the elements is greater than the + // viewport then then scrollTo element would not be in view + var prevElmHeight = element.prev().height(); + padTop = (prevElmHeight + elmHeight <= containerHeight) ? prevElmHeight : 0; + var nextElmHeight = element.next().height(); + padBottom = (nextElmHeight + elmHeight <= containerHeight) ? nextElmHeight : 0; + } + + // if the top of the row is ABOVE the view port move the row into position + if ((elmPosTop - padTop) < containerScrollTop) { + that.scrollingElm[0].scrollTop = elmPosTop - padTop; + } + + // if the bottom of the row is BELOW the viewport then scroll it into position + if (((elmPosTop + elmHeight) + padBottom) > (containerScrollTop + containerHeight)) { + elmHeight = (elmHeight < containerHeight) ? elmHeight : containerHeight; + that.scrollingElm[0].scrollTop = (elmPosTop - containerHeight + elmHeight + padBottom); + } + }; + + var setupScroller = function (that) { + that.scrollingElm = that.container.parents(that.options.selectors.wrapper); + + // We should render our own sensible default if the scrolling element is missing. + if (!that.scrollingElm.length) { + fluid.fail({ + name: "Missing Scroller", + message: "The scroller wrapper element was not found." + }); + } + + // set the height of the scroller unless this is IE6 + if (!$.browser.msie || $.browser.version > 6) { + that.scrollingElm.css("max-height", that.options.maxHeight); + } + }; + + /** + * Creates a new Scroller component. + * + * @param {Object} container the element containing the collection of things to make scrollable + * @param {Object} options configuration options for the component + */ + fluid.scroller = function (container, options) { + var that = fluid.initView("fluid.scroller", container, options); + setupScroller(that); + + /** + * Scrolls the specified element into view + * + * @param {jQuery} element the element to scroll into view + */ + that.scrollTo = function (element) { + scrollTo(that, element); + }; + + /** + * Scrolls to the bottom of the view. + */ + that.scrollBottom = function () { + scrollBottom(that); + }; + + /** + * Refreshes the scroller's appearance based on any changes to the document. + */ + that.refreshView = function () { + if ($.browser.msie && $.browser.version < 7) { + refreshView(that); + } + }; + + that.refreshView(); + return that; + }; + + fluid.defaults("fluid.scroller", { + selectors: { + wrapper: ".flc-scroller" + }, + + maxHeight: 180, + + padScroll: true + }); + +})(jQuery, fluid_1_0); Property changes on: messageforums-app/src/webapp/js/Scroller.js ___________________________________________________________________ Added: svn:eol-style + native Index: messageforums-app/src/webapp/js/forum.js =================================================================== --- messageforums-app/src/webapp/js/forum.js (revision 121251) +++ messageforums-app/src/webapp/js/forum.js (working copy) @@ -622,6 +622,22 @@ }); +function resizeFrameForDialog() +{ + if (top.location != self.location) { + var frame = parent.document.getElementById(window.name); + } + if( frame ) { + var clientH = document.body.clientHeight + 400; + $( frame ).height( clientH ); + } + else { + throw( "resizeFrame did not get the frame (using name=" + window.name + ")" ); + } +} + + + $(document).ready(function(){ $('.blockMe').click(function(e){ var buttonContainer = $(this).parents('.act'); Index: messageforums-app/src/webapp/js/jquery.bgiframe.js =================================================================== --- messageforums-app/src/webapp/js/jquery.bgiframe.js (revision 0) +++ messageforums-app/src/webapp/js/jquery.bgiframe.js (revision 0) @@ -0,0 +1,104 @@ +/* Copyright (c) 2006 Brandon Aaron (http://brandonaaron.net) + * Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php) + * and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses. + * + * $LastChangedDate: 2009-05-05 08:14:12 -0700 (Tue, 05 May 2009) $ + * $Rev: 7137 $ + * + * Version 2.1 + */ + +(function($){ + +/** + * The bgiframe is chainable and applies the iframe hack to get + * around zIndex issues in IE6. It will only apply itself in IE + * and adds a class to the iframe called 'bgiframe'. The iframe + * is appeneded as the first child of the matched element(s) + * with a tabIndex and zIndex of -1. + * + * By default the plugin will take borders, sized with pixel units, + * into account. If a different unit is used for the border's width, + * then you will need to use the top and left settings as explained below. + * + * NOTICE: This plugin has been reported to cause perfromance problems + * when used on elements that change properties (like width, height and + * opacity) a lot in IE6. Most of these problems have been caused by + * the expressions used to calculate the elements width, height and + * borders. Some have reported it is due to the opacity filter. All + * these settings can be changed if needed as explained below. + * + * @example $('div').bgiframe(); + * @before
Paragraph
Paragraph
null if no
+ * such key is found.
+ */
+ fluid.keyForValue = function (obj, value) {
+ for (var key in obj) {
+ if (obj[key] === value) {
+ return key;
+ }
+ }
+ return null;
+ };
+
+ /**
+ * This method is now deprecated and will be removed in a future release of Infusion.
+ * See fluid.keyForValue instead.
+ */
+ fluid.findKeyInObject = fluid.keyForValue;
+
+ /**
+ * Clears an object or array of its contents. For objects, each property is deleted.
+ *
+ * @param {Object|Array} target the target to be cleared
+ */
+ fluid.clear = function (target) {
+ if (target instanceof Array) {
+ target.length = 0;
+ }
+ else {
+ for (var i in target) {
+ delete target[i];
+ }
+ }
+ };
+
+
+ // Framework and instantiation functions.
+
+ /**
+ * Fetches a single container element and returns it as a jQuery.
+ *
+ * @param {String||jQuery||element} an id string, a single-element jQuery, or a DOM element specifying a unique container
+ * @return a single-element jQuery of container
+ */
+ fluid.container = function (containerSpec) {
+ var container = containerSpec;
+ if (typeof containerSpec === "string" ||
+ containerSpec.nodeType && (containerSpec.nodeType === 1 || containerSpec.nodeType === 9)) {
+ container = $(containerSpec);
+ }
+
+ // Throw an exception if we've got more or less than one element.
+ if (!container || !container.jquery || container.length !== 1) {
+ if (typeof(containerSpec) !== "string") {
+ containerSpec = container.selector;
+ }
+ fluid.fail({
+ name: "NotOne",
+ message: "A single container element was not found for selector " + containerSpec
+ });
+ }
+
+ return container;
+ };
+
+ /**
+ * Retreives and stores a component's default settings centrally.
+ * @param {boolean} (options) if true, manipulate a global option (for the head
+ * component) rather than instance options.
+ * @param {String} componentName the name of the component
+ * @param {Object} (optional) an container of key/value pairs to set
+ *
+ */
+ var defaultsStore = {};
+ var globalDefaultsStore = {};
+ fluid.defaults = function () {
+ var offset = 0;
+ var store = defaultsStore;
+ if (typeof arguments[0] === "boolean") {
+ store = globalDefaultsStore;
+ offset = 1;
+ }
+ var componentName = arguments[offset];
+ var defaultsObject = arguments[offset + 1];
+ if (defaultsObject !== undefined) {
+ store[componentName] = defaultsObject;
+ return defaultsObject;
+ }
+
+ return store[componentName];
+ };
+
+ /**
+ * Creates a new DOM Binder instance, used to locate elements in the DOM by name.
+ *
+ * @param {Object} container the root element in which to locate named elements
+ * @param {Object} selectors a collection of named jQuery selectors
+ */
+ fluid.createDomBinder = function (container, selectors) {
+ var cache = {}, that = {};
+
+ function cacheKey(name, thisContainer) {
+ return $.data(fluid.unwrap(thisContainer)) + "-" + name;
+ }
+
+ function record(name, thisContainer, result) {
+ cache[cacheKey(name, thisContainer)] = result;
+ }
+
+ that.locate = function (name, localContainer) {
+ var selector, thisContainer, togo;
+
+ selector = selectors[name];
+ thisContainer = localContainer? localContainer: container;
+ if (!thisContainer) {
+ fluid.fail("DOM binder invoked for selector " + name + " without container");
+ }
+
+ if (!selector) {
+ return thisContainer;
+ }
+
+ if (typeof(selector) === "function") {
+ togo = $(selector.call(null, fluid.unwrap(thisContainer)));
+ } else {
+ togo = $(selector, thisContainer);
+ }
+ if (togo.get(0) === document) {
+ togo = [];
+ //fluid.fail("Selector " + name + " with value " + selectors[name] +
+ // " did not find any elements with container " + fluid.dumpEl(container));
+ }
+ if (!togo.selector) {
+ togo.selector = selector;
+ togo.context = thisContainer;
+ }
+ togo.selectorName = name;
+ record(name, thisContainer, togo);
+ return togo;
+ };
+ that.fastLocate = function (name, localContainer) {
+ var thisContainer = localContainer? localContainer: container;
+ var key = cacheKey(name, thisContainer);
+ var togo = cache[key];
+ return togo? togo : that.locate(name, localContainer);
+ };
+ that.clear = function () {
+ cache = {};
+ };
+ that.refresh = function (names, localContainer) {
+ var thisContainer = localContainer? localContainer: container;
+ if (typeof names === "string") {
+ names = [names];
+ }
+ if (thisContainer.length === undefined) {
+ thisContainer = [thisContainer];
+ }
+ for (var i = 0; i < names.length; ++ i) {
+ for (var j = 0; j < thisContainer.length; ++ j) {
+ that.locate(names[i], thisContainer[j]);
+ }
+ }
+ };
+
+ return that;
+ };
+
+ /**
+ * Attaches the user's listeners to a set of events.
+ *
+ * @param {Object} events a collection of named event firers
+ * @param {Object} listeners optional listeners to add
+ */
+ fluid.mergeListeners = function (events, listeners) {
+ if (listeners) {
+ for (var key in listeners) {
+ var value = listeners[key];
+ var keydot = key.indexOf(".");
+ var namespace;
+ if (keydot !== -1) {
+ namespace = key.substring(keydot + 1);
+ key = key.substring(0, keydot);
+ }
+ if (!events[key]) {
+ events[key] = fluid.event.getEventFirer();
+ }
+ var firer = events[key];
+ if (typeof(value) === "function") {
+ firer.addListener(value, namespace);
+ }
+ else if (value && typeof value.length === "number") {
+ for (var i = 0; i < value.length; ++ i) {
+ firer.addListener(value[i], namespace);
+ }
+ }
+ }
+ }
+ };
+
+ /**
+ * Sets up a component's declared events.
+ * Events are specified in the options object by name. There are three different types of events that can be
+ * specified:
+ * 1. an ordinary multicast event, specified by "null.
+ * 2. a unicast event, which allows only one listener to be registered
+ * 3. a preventable event
+ *
+ * @param {Object} that the component
+ * @param {Object} options the component's options structure, containing the declared event names and types
+ */
+ fluid.instantiateFirers = function (that, options) {
+ that.events = {};
+ if (options.events) {
+ for (var event in options.events) {
+ var eventType = options.events[event];
+ that.events[event] = fluid.event.getEventFirer(eventType === "unicast", eventType === "preventable");
+ }
+ }
+ fluid.mergeListeners(that.events, options.listeners);
+ };
+
+ /**
+ * Merges the component's declared defaults, as obtained from fluid.defaults(),
+ * with the user's specified overrides.
+ *
+ * @param {Object} that the instance to attach the options to
+ * @param {String} componentName the unique "name" of the component, which will be used
+ * to fetch the default options from store. By recommendation, this should be the global
+ * name of the component's creator function.
+ * @param {Object} userOptions the user-specified configuration options for this component
+ */
+ fluid.mergeComponentOptions = function (that, componentName, userOptions) {
+ var defaults = fluid.defaults(componentName);
+ that.options = fluid.merge(defaults? defaults.mergePolicy: null, {}, defaults, userOptions);
+ };
+
+
+ /** Expect that an output from the DOM binder has resulted in a non-empty set of
+ * results. If none are found, this function will fail with a diagnostic message,
+ * with the supplied message prepended.
+ */
+ fluid.expectFilledSelector = function (result, message) {
+ if (result && result.length === 0 && result.jquery) {
+ fluid.fail(message + ": selector \"" + result.selector + "\" with name " + result.selectorName +
+ " returned no results in context " + fluid.dumpEl(result.context));
+ }
+ };
+
+ /**
+ * The central initialiation method called as the first act of every Fluid
+ * component. This function automatically merges user options with defaults,
+ * attaches a DOM Binder to the instance, and configures events.
+ *
+ * @param {String} componentName The unique "name" of the component, which will be used
+ * to fetch the default options from store. By recommendation, this should be the global
+ * name of the component's creator function.
+ * @param {jQueryable} container A specifier for the single root "container node" in the
+ * DOM which will house all the markup for this component.
+ * @param {Object} userOptions The configuration options for this component.
+ */
+ fluid.initView = function (componentName, container, userOptions) {
+ var that = {};
+ fluid.expectFilledSelector(container, "Error instantiating component with name \"" + componentName);
+ fluid.mergeComponentOptions(that, componentName, userOptions);
+
+ if (container) {
+ that.container = fluid.container(container);
+ fluid.initDomBinder(that);
+ }
+ fluid.instantiateFirers(that, that.options);
+
+ return that;
+ };
+
+ /** A special "marker object" which is recognised as one of the arguments to
+ * fluid.initSubcomponents. This object is recognised by reference equality -
+ * where it is found, it is replaced in the actual argument position supplied
+ * to the specific subcomponent instance, with the particular options block
+ * for that instance attached to the overall "that" object.
+ */
+ fluid.COMPONENT_OPTIONS = {};
+
+ /** Another special "marker object" representing that a distinguished
+ * (probably context-dependent) value should be substituted.
+ */
+ fluid.VALUE = {};
+
+ /** Construct a dummy or "placeholder" subcomponent, that optionally provides empty
+ * implementations for a set of methods.
+ */
+ fluid.emptySubcomponent = function (options) {
+ var that = {};
+ options = $.makeArray(options);
+ for (var i = 0; i < options.length; ++ i) {
+ that[options[i]] = function () {};
+ }
+ return that;
+ };
+
+ fluid.initSubcomponent = function (that, className, args) {
+ return fluid.initSubcomponents(that, className, args)[0];
+ };
+
+ /** Initialise all the "subcomponents" which are configured to be attached to
+ * the supplied top-level component, which share a particular "class name".
+ * @param {Component} that The top-level component for which sub-components are
+ * to be instantiated. It contains specifications for these subcomponents in its
+ * options structure.
+ * @param {String} className The "class name" or "category" for the subcomponents to
+ * be instantiated. A class name specifies an overall "function" for a class of
+ * subcomponents and represents a category which accept the same signature of
+ * instantiation arguments.
+ * @param {Array of Object} args The instantiation arguments to be passed to each
+ * constructed subcomponent. These will typically be members derived from the
+ * top-level that or perhaps globally discovered from elsewhere. One
+ * of these arguments may be fluid.COMPONENT_OPTIONS in which case this
+ * placeholder argument will be replaced by instance-specific options configured
+ * into the member of the top-level options structure named for the
+ * className
+ * @return {Array of Object} The instantiated subcomponents, one for each member
+ * of that.options[className].
+ */
+
+ fluid.initSubcomponents = function (that, className, args) {
+ var entry = that.options[className];
+ if (!entry) {
+ return;
+ }
+ var entries = $.makeArray(entry);
+ var optindex = -1;
+ var togo = [];
+ args = $.makeArray(args);
+ for (var i = 0; i < args.length; ++ i) {
+ if (args[i] === fluid.COMPONENT_OPTIONS) {
+ optindex = i;
+ }
+ }
+ for (i = 0; i < entries.length; ++ i) {
+ entry = entries[i];
+ if (optindex !== -1 && entry.options) {
+ args[optindex] = entry.options;
+ }
+ if (typeof(entry) !== "function") {
+ var entryType = typeof(entry) === "string"? entry : entry.type;
+ var globDef = fluid.defaults(true, entryType);
+ fluid.merge("reverse", that.options, globDef);
+ togo[i] = entryType === "fluid.emptySubcomponent"?
+ fluid.emptySubcomponent(entry.options) :
+ fluid.invokeGlobalFunction(entryType, args, {fluid: fluid});
+ }
+ else {
+ togo[i] = entry.apply(null, args);
+ }
+
+ var returnedOptions = togo[i]? togo[i].returnedOptions : null;
+ if (returnedOptions) {
+ fluid.merge(that.options.mergePolicy, that.options, returnedOptions);
+ if (returnedOptions.listeners) {
+ fluid.mergeListeners(that.events, returnedOptions.listeners);
+ }
+ }
+ }
+ return togo;
+ };
+
+ /**
+ * Creates a new DOM Binder instance for the specified component and mixes it in.
+ *
+ * @param {Object} that the component instance to attach the new DOM Binder to
+ */
+ fluid.initDomBinder = function (that) {
+ that.dom = fluid.createDomBinder(that.container, that.options.selectors);
+ that.locate = that.dom.locate;
+ };
+
+
+ /** Returns true if the argument is a primitive type **/
+ fluid.isPrimitive = function (value) {
+ var valueType = typeof(value);
+ return !value || valueType === "string" || valueType === "boolean" || valueType === "number";
+ };
+
+ function mergeImpl(policy, basePath, target, source) {
+ var thisPolicy = policy && typeof(policy) !== "string"? policy[basePath] : policy;
+ if (typeof(thisPolicy) === "function") {
+ thisPolicy.apply(null, target, source);
+ return target;
+ }
+ if (thisPolicy === "replace") {
+ fluid.clear(target);
+ }
+
+ for (var name in source) {
+ var path = (basePath? basePath + ".": "") + name;
+ var thisTarget = target[name];
+ var thisSource = source[name];
+ var primitiveTarget = fluid.isPrimitive(thisTarget);
+
+ if (thisSource !== undefined) {
+ if (thisSource !== null && typeof thisSource === 'object' &&
+ !thisSource.nodeType && !thisSource.jquery && thisSource !== fluid.VALUE) {
+ if (primitiveTarget) {
+ target[name] = thisTarget = thisSource instanceof Array? [] : {};
+ }
+ mergeImpl(policy, path, thisTarget, thisSource);
+ }
+ else {
+ if (thisTarget === null || thisTarget === undefined || thisPolicy !== "reverse") {
+ target[name] = thisSource;
+ }
+ }
+ }
+ }
+ return target;
+ }
+
+ /** Merge a collection of options structures onto a target, following an optional policy.
+ * This function is typically called automatically, as a result of an invocation of
+ * fluid.iniView. The behaviour of this function is explained more fully on
+ * the page http://wiki.fluidproject.org/display/fluid/Options+Merging+for+Fluid+Components .
+ * @param policy {Object/String} A "policy object" specifiying the type of merge to be performed.
+ * If policy is of type {String} it should take on the value "reverse" or "replace" representing
+ * a static policy. If it is an
+ * Object, it should contain a mapping of EL paths onto these String values, representing a
+ * fine-grained policy. If it is an Object, the values may also themselves be EL paths
+ * representing that a default value is to be taken from that path.
+ * @param target {Object} The options structure which is to be modified by receiving the merge results.
+ * @param options1, options2, .... {Object} an arbitrary list of options structure which are to
+ * be merged "on top of" the target. These will not be modified.
+ */
+
+ fluid.merge = function (policy, target) {
+ var path = "";
+
+ for (var i = 2; i < arguments.length; ++i) {
+ var source = arguments[i];
+ if (source !== null && source !== undefined) {
+ mergeImpl(policy, path, target, source);
+ }
+ }
+ if (policy && typeof(policy) !== "string") {
+ for (var key in policy) {
+ var elrh = policy[key];
+ if (typeof(elrh) === 'string' && elrh !== "replace") {
+ var oldValue = fluid.model.getBeanValue(target, key);
+ if (oldValue === null || oldValue === undefined) {
+ var value = fluid.model.getBeanValue(target, elrh);
+ fluid.model.setBeanValue(target, key, value);
+ }
+ }
+ }
+ }
+ return target;
+ };
+
+ /** Performs a deep copy (clone) of its argument **/
+
+ fluid.copy = function (tocopy) {
+ return $.extend(true, {}, tocopy);
+ };
+
+ fluid.invokeGlobalFunction = function (functionPath, args, environment) {
+ var func = fluid.model.getBeanValue(window, functionPath, environment);
+ if (!func) {
+ fluid.fail("Error invoking global function: " + functionPath + " could not be located");
+ } else {
+ return func.apply(null, args);
+ }
+ };
+
+
+ // The Model Events system.
+
+ fluid.event = {};
+
+ var fluid_guid = 1;
+ /** Construct an "event firer" object which can be used to register and deregister
+ * listeners, to which "events" can be fired. These events consist of an arbitrary
+ * function signature. General documentation on the Fluid events system is at
+ * http://wiki.fluidproject.org/display/fluid/The+Fluid+Event+System .
+ * @param {Boolean} unicast If true, this is a "unicast" event which may only accept
+ * a single listener.
+ * @param {Boolean} preventable If true the return value of each handler will
+ * be checked for true in which case further listeners will be shortcircuited, and this
+ * will be the return value of fire()
+ */
+
+ fluid.event.getEventFirer = function (unicast, preventable) {
+ var log = fluid.log;
+ var listeners = {};
+ return {
+ addListener: function (listener, namespace, predicate) {
+ if (!listener) {
+ return;
+ }
+ if (unicast) {
+ namespace = "unicast";
+ }
+ if (!namespace) {
+ if (!listener.$$guid) {
+ listener.$$guid = fluid_guid++;
+ }
+ namespace = listener.$$guid;
+ }
+
+ listeners[namespace] = {listener: listener, predicate: predicate};
+ },
+
+ removeListener: function (listener) {
+ if (typeof(listener) === 'string') {
+ delete listeners[listener];
+ }
+ else if (typeof(listener) === 'object' && listener.$$guid) {
+ delete listeners[listener.$$guid];
+ }
+ },
+
+ fire: function () {
+ for (var i in listeners) {
+ var lisrec = listeners[i];
+ var listener = lisrec.listener;
+ if (lisrec.predicate && !lisrec.predicate(listener, arguments)) {
+ continue;
+ }
+ try {
+ var ret = listener.apply(null, arguments);
+ if (preventable && ret === false) {
+ return false;
+ }
+ }
+ catch (e) {
+ log("FireEvent received exception " + e.message + " e " + e + " firing to listener " + i);
+ throw (e);
+ }
+ }
+ }
+ };
+ };
+
+
+ // Model functions
+
+ fluid.model = {};
+
+ /** Copy a source "model" onto a target **/
+ fluid.model.copyModel = function (target, source) {
+ fluid.clear(target);
+ $.extend(true, target, source);
+ };
+
+ /** Parse an EL expression separated by periods (.) into its component segments.
+ * @param {String} EL The EL expression to be split
+ * @return {Array of String} the component path expressions.
+ * TODO: This needs to be upgraded to handle (the same) escaping rules (as RSF), so that
+ * path segments containing periods and backslashes etc. can be processed.
+ */
+ fluid.model.parseEL = function (EL) {
+ return EL.toString().split('.');
+ };
+
+ fluid.model.composePath = function (prefix, suffix) {
+ return prefix === ""? suffix : prefix + "." + suffix;
+ };
+
+ /** This function implements the RSF "DARApplier" **/
+ fluid.model.setBeanValue = function (root, EL, newValue) {
+ var segs = fluid.model.parseEL(EL);
+ for (var i = 0; i < segs.length - 1; i += 1) {
+ if (!root[segs[i]]) {
+ root[segs[i]] = {};
+ }
+ root = root[segs[i]];
+ }
+ root[segs[segs.length - 1]] = newValue;
+ };
+
+ /** Evaluates an EL expression by fetching a dot-separated list of members
+ * recursively from a provided root.
+ * @param root The root data structure in which the EL expression is to be evaluated
+ * @param {string} EL The EL expression to be evaluated
+ * @param environment An optional "environment" which, if it contains any members
+ * at top level, will take priority over the root data structure.
+ * @return The fetched data value.
+ */
+
+ fluid.model.getBeanValue = function (root, EL, environment) {
+ if (EL === "" || EL === null || EL === undefined) {
+ return root;
+ }
+ var segs = fluid.model.parseEL(EL);
+ for (var i = 0; i < segs.length; ++i) {
+ if (!root) {
+ return root;
+ }
+ var segment = segs[i];
+ if (environment && environment[segment]) {
+ root = environment[segment];
+ environment = null;
+ }
+ else {
+ root = root[segment];
+ }
+ }
+ return root;
+ };
+
+
+ // Logging
+ var logging;
+ /** method to allow user to enable logging (off by default) */
+ fluid.setLogging = function (enabled) {
+ if (typeof enabled === "boolean") {
+ logging = enabled;
+ } else {
+ logging = false;
+ }
+ };
+
+ /** Log a message to a suitable environmental console. If the standard "console"
+ * stream is available, the message will be sent there - otherwise either the
+ * YAHOO logger or the Opera "postError" stream will be used. Logging must first
+ * be enabled with a call fo the fluid.setLogging(true) function.
+ */
+ fluid.log = function (str) {
+ if (logging) {
+ str = new Date().toTimeString() + ": " + str;
+ if (typeof(console) !== "undefined") {
+ if (console.debug) {
+ console.debug(str);
+ } else {
+ console.log(str);
+ }
+ }
+ else if (typeof(YAHOO) !== "undefined") {
+ YAHOO.log(str);
+ }
+ else if (typeof(opera) !== "undefined") {
+ opera.postError(str);
+ }
+ }
+ };
+
+ /**
+ * Dumps a DOM element into a readily recognisable form for debugging - produces a
+ * "semi-selector" summarising its tag name, class and id, whichever are set.
+ *
+ * @param {jQueryable} element The element to be dumped
+ * @return A string representing the element.
+ */
+ fluid.dumpEl = function (element) {
+ var togo;
+
+ if (!element) {
+ return "null";
+ }
+ if (element.nodeType === 3 || element.nodeType === 8) {
+ return "[data: " + element.data + "]";
+ }
+ if (element.nodeType === 9) {
+ return "[document: location " + element.location + "]";
+ }
+ if (typeof element.length === "number") {
+ togo = "[";
+ for (var i = 0; i < element.length; ++ i) {
+ togo += fluid.dumpEl(element[i]);
+ if (i < element.length - 1) {
+ togo += ", ";
+ }
+ }
+ return togo + "]";
+ }
+ element = $(element);
+ togo = element.get(0).tagName;
+ if (element.attr("id")) {
+ togo += "#" + element.attr("id");
+ }
+ if (element.attr("class")) {
+ togo += "." + element.attr("class");
+ }
+ return togo;
+ };
+
+ // DOM Utilities.
+
+ /**
+ * Finds the nearest ancestor of the element that passes the test
+ * @param {Element} element DOM element
+ * @param {Function} test A function which takes an element as a parameter and return true or false for some test
+ */
+ fluid.findAncestor = function (element, test) {
+ element = fluid.unwrap(element);
+ while (element) {
+ if (test(element)) {
+ return element;
+ }
+ element = element.parentNode;
+ }
+ };
+
+ /**
+ * Returns a jQuery object given the id of a DOM node. In the case the element
+ * is not found, will return an empty list.
+ */
+ fluid.jById = function (id, dokkument) {
+ dokkument = dokkument && dokkument.nodeType === 9? dokkument : document;
+ var element = fluid.byId(id, dokkument);
+ var togo = element? $(element) : [];
+ togo.selector = "#" + id;
+ togo.context = dokkument;
+ return togo;
+ };
+
+ /**
+ * Returns an DOM element quickly, given an id
+ *
+ * @param {Object} id the id of the DOM node to find
+ * @param {Document} dokkument the document in which it is to be found (if left empty, use the current document)
+ * @return The DOM element with this id, or null, if none exists in the document.
+ */
+ fluid.byId = function (id, dokkument) {
+ dokkument = dokkument && dokkument.nodeType === 9? dokkument : document;
+ var el = dokkument.getElementById(id);
+ if (el) {
+ if (el.getAttribute("id") !== id) {
+ fluid.fail("Problem in document structure - picked up element " +
+ fluid.dumpEl(el) +
+ " for id " +
+ id +
+ " without this id - most likely the element has a name which conflicts with this id");
+ }
+ return el;
+ }
+ else {
+ return null;
+ }
+ };
+
+ /**
+ * Returns the id attribute from a jQuery or pure DOM element.
+ *
+ * @param {jQuery||Element} element the element to return the id attribute for
+ */
+ fluid.getId = function (element) {
+ return fluid.unwrap(element).getAttribute("id");
+ };
+
+ /**
+ * Allocate an id to the supplied element if it has none already, by a simple
+ * scheme resulting in ids "fluid-id-nnnn" where nnnn is an increasing integer.
+ */
+
+ fluid.allocateSimpleId = function (element) {
+ element = fluid.unwrap(element);
+ if (!element.id) {
+ element.id = "fluid-id-" + (fluid_guid++);
+ }
+ return element.id;
+ };
+
+
+ // Functional programming utilities.
+
+ /** Return a list of objects, transformed by one or more functions. Similar to
+ * jQuery.map, only will accept an arbitrary list of transformation functions.
+ * @param list {Array} The initial array of objects to be transformed.
+ * @param fn1, fn2, etc. {Function} An arbitrary number of optional further arguments,
+ * all of type Function, accepting the signature (object, index), where object is the
+ * list member to be transformed, and index is its list index. Each function will be
+ * applied in turn to each list member, which will be replaced by the return value
+ * from the function.
+ * @return The finally transformed list, where each member has been replaced by the
+ * original member acted on by the function or functions.
+ */
+ fluid.transform = function (list) {
+ var togo = [];
+ for (var i = 0; i < list.length; ++ i) {
+ var transit = list[i];
+ for (var j = 0; j < arguments.length - 1; ++ j) {
+ transit = arguments[j + 1](transit, i);
+ }
+ togo[togo.length] = transit;
+ }
+ return togo;
+ };
+
+ /** Scan through a list of objects, terminating on and returning the first member which
+ * matches a predicate function.
+ * @param list {Array} The list of objects to be searched.
+ * @param fn {Function} A predicate function, acting on a list member. A predicate which
+ * returns any value which is not null or undefined will terminate
+ * the search. The function accepts (object, index).
+ * @param deflt {Object} A value to be returned in the case no predicate function matches
+ * a list member. The default will be the natural value of undefined
+ * @return The first return value from the predicate function which is not null
+ * or undefined
+ */
+ fluid.find = function (list, fn, deflt) {
+ for (var i = 0; i < list.length; ++ i) {
+ var transit = fn(list[i], i);
+ if (transit !== null && transit !== undefined) {
+ return transit;
+ }
+ }
+ return deflt;
+ };
+
+ /** Scan through a list of objects, "accumulating" a value over them
+ * (may be a straightforward "sum" or some other chained computation).
+ * @param list {Array} The list of objects to be accumulated over.
+ * @param fn {Function} An "accumulation function" accepting the signature (object, total, index) where
+ * object is the list member, total is the "running total" object (which is the return value from the previous function),
+ * and index is the index number.
+ * @param arg {Object} The initial value for the "running total" object.
+ * @return {Object} the final running total object as returned from the final invocation of the function on the last list member.
+ */
+ fluid.accumulate = function (list, fn, arg) {
+ for (var i = 0; i < list.length; ++ i) {
+ arg = fn(list[i], arg, i);
+ }
+ return arg;
+ };
+
+ /** Can through a list of objects, removing those which match a predicate. Similar to
+ * jQuery.grep, only acts on the list in-place by removal, rather than by creating
+ * a new list by inclusion.
+ * @param list {Array} The list of objects to be scanned over.
+ * @param fn {Function} A predicate function determining whether an element should be
+ * removed. This accepts the standard signature (object, index) and returns a "truthy"
+ * result in order to determine that the supplied object should be removed from the list.
+ * @return The list, transformed by the operation of removing the matched elements. The
+ * supplied list is modified by this operation.
+ */
+ fluid.remove_if = function (list, fn) {
+ for (var i = 0; i < list.length; ++ i) {
+ if (fn(list[i], i)) {
+ list.splice(i, 1);
+ --i;
+ }
+ }
+ return list;
+ };
+
+ /**
+ * Expand a message string with respect to a set of arguments, following a basic
+ * subset of the Java MessageFormat rules.
+ * http://java.sun.com/j2se/1.4.2/docs/api/java/text/MessageFormat.html
+ *
+ * The message string is expected to contain replacement specifications such
+ * as {0}, {1}, {2}, etc.
+ * @param messageString {String} The message key to be expanded
+ * @param args {String/Array of String} An array of arguments to be substituted into the message.
+ * @return The expanded message string.
+ */
+ fluid.formatMessage = function (messageString, args) {
+ if (!args) {
+ return messageString;
+ }
+ if (typeof(args) === "string") {
+ args = [args];
+ }
+ for (var i = 0; i < args.length; ++ i) {
+ messageString = messageString.replace("{" + i + "}", args[i]);
+ }
+ return messageString;
+ };
+
+ /** Converts a data structure consisting of a mapping of keys to message strings,
+ * into a "messageLocator" function which maps an array of message codes, to be
+ * tried in sequence until a key is found, and an array of substitution arguments,
+ * into a substituted message string.
+ */
+ fluid.messageLocator = function (messageBase) {
+ return function (messagecodes, args) {
+ if (typeof(messagecodes) === "string") {
+ messagecodes = [messagecodes];
+ }
+ for (var i = 0; i < messagecodes.length; ++ i) {
+ var code = messagecodes[i];
+ var message = messageBase[code];
+ if (message === undefined) {
+ continue;
+ }
+ return fluid.formatMessage(message, args);
+ }
+ return "[Message string for key " + messagecodes[0] + " not found]";
+ };
+ };
+
+ // Other useful helpers.
+
+ /**
+ * Simple string template system.
+ * Takes a template string containing tokens in the form of "%value".
+ * Returns a new string with the tokens replaced by the specified values.
+ * Keys and values can be of any data type that can be coerced into a string. Arrays will work here as well.
+ *
+ * @param {String} template a string (can be HTML) that contains tokens embedded into it
+ * @param {object} values a collection of token keys and values
+ */
+ fluid.stringTemplate = function (template, values) {
+ var newString = template;
+ for (var key in values) {
+ if (values.hasOwnProperty(key)) {
+ var searchStr = "%" + key;
+ newString = newString.replace(searchStr, values[key]);
+ }
+ }
+ return newString;
+ };
+
+})(jQuery, fluid_1_0);
+/*
+Copyright 2008-2009 University of Cambridge
+Copyright 2008-2009 University of Toronto
+Copyright 2007-2009 University of California, Berkeley
+
+Licensed under the Educational Community License (ECL), Version 2.0 or the New
+BSD license. You may not use this file except in compliance with one these
+Licenses.
+
+You may obtain a copy of the ECL 2.0 License and BSD License at
+https://source.fluidproject.org/svn/LICENSE.txt
+*/
+
+// Declare dependencies.
+/*global jQuery */
+
+var fluid_1_0 = fluid_1_0 || {};
+
+(function ($, fluid) {
+
+ fluid.dom = fluid.dom || {};
+
+ // Node walker function for iterateDom.
+ var getNextNode = function (iterator) {
+ if (iterator.node.firstChild) {
+ iterator.node = iterator.node.firstChild;
+ iterator.depth += 1;
+ return iterator;
+ }
+ while (iterator.node) {
+ if (iterator.node.nextSibling) {
+ iterator.node = iterator.node.nextSibling;
+ return iterator;
+ }
+ iterator.node = iterator.node.parentNode;
+ iterator.depth -= 1;
+ }
+ return iterator;
+ };
+
+ /**
+ * Walks the DOM, applying the specified acceptor function to each element.
+ * There is a special case for the acceptor, allowing for quick deletion of elements and their children.
+ * Return true from your acceptor function if you want to delete the element in question.
+ *
+ * @param {Element} node the node to start walking from
+ * @param {Function} acceptor the function to invoke with each DOM element
+ */
+ fluid.dom.iterateDom = function (node, acceptor) {
+ var currentNode = {node: node, depth: 0};
+ var prevNode = node;
+ while (currentNode.node !== null && currentNode.depth >= 0 && currentNode.depth < fluid.dom.iterateDom.DOM_BAIL_DEPTH) {
+ var deleted = false;
+ if (currentNode.node.nodeType === 1) {
+ deleted = acceptor(currentNode.node, currentNode.depth);
+ }
+ if (deleted) {
+ currentNode.node.parentNode.removeChild(currentNode.node);
+ currentNode.node = prevNode;
+ }
+ prevNode = currentNode.node;
+ currentNode = getNextNode(currentNode);
+ }
+ };
+
+ // Work around IE circular DOM issue. This is the default max DOM depth on IE.
+ // http://msdn2.microsoft.com/en-us/library/ms761392(VS.85).aspx
+ fluid.dom.iterateDom.DOM_BAIL_DEPTH = 256;
+
+ /**
+ * Returns the absolute position of a supplied DOM node in pixels.
+ * Implementation taken from quirksmode http://www.quirksmode.org/js/findpos.html
+ */
+ fluid.dom.computeAbsolutePosition = function (element) {
+ var curleft = 0, curtop = 0;
+ if (element.offsetParent) {
+ do {
+ curleft += element.offsetLeft;
+ curtop += element.offsetTop;
+ element = element.offsetParent;
+ } while (element);
+ return [curleft, curtop];
+ }
+ };
+
+ /**
+ * Checks if the sepcified container is actually the parent of containee.
+ *
+ * @param {Element} container the potential parent
+ * @param {Element} containee the child in question
+ */
+ fluid.dom.isContainer = function (container, containee) {
+ for (; containee; containee = containee.parentNode) {
+ if (container === containee) {
+ return true;
+ }
+ }
+ return false;
+ };
+
+ /** Mockup of a missing DOM function **/
+ fluid.dom.insertAfter = function (newChild, refChild) {
+ var nextSib = refChild.nextSibling;
+ if (!nextSib) {
+ refChild.parentNode.appendChild(newChild);
+ }
+ else {
+ refChild.parentNode.insertBefore(newChild, nextSib);
+ }
+ };
+
+ // The following two functions taken from http://developer.mozilla.org/En/Whitespace_in_the_DOM
+ /**
+ * Determine whether a node's text content is entirely whitespace.
+ *
+ * @param node A node implementing the |CharacterData| interface (i.e.,
+ * a |Text|, |Comment|, or |CDATASection| node
+ * @return True if all of the text content of |nod| is whitespace,
+ * otherwise false.
+ */
+ fluid.dom.isWhitespaceNode = function (node) {
+ // Use ECMA-262 Edition 3 String and RegExp features
+ return !(/[^\t\n\r ]/.test(node.data));
+ };
+
+ /**
+ * Determine if a node should be ignored by the iterator functions.
+ *
+ * @param nod An object implementing the DOM1 |Node| interface.
+ * @return true if the node is:
+ * 1) A |Text| node that is all whitespace
+ * 2) A |Comment| node
+ * and otherwise false.
+ */
+ fluid.dom.isIgnorableNode = function (node) {
+ return (node.nodeType === 8) || // A comment node
+ ((node.nodeType === 3) && fluid.dom.isWhitespaceNode(node)); // a text node, all ws
+ };
+
+ /** Return the element text from the supplied DOM node as a single String */
+ fluid.dom.getElementText = function(element) {
+ var nodes = element.childNodes;
+ var text = "";
+ for (var i = 0; i < nodes.length; ++ i) {
+ var child = nodes[i];
+ if (child.nodeType == 3) {
+ text = text + child.nodeValue;
+ }
+ }
+ return text;
+ };
+
+ /**
+ * Cleanse the children of a DOM node by removing all
+ |
+
+
+
+
+ |
+
+
+
+
+
+
+